Use the observations about each chemical reaction in the table below to decide the sign (positive or negative) of the reaction em reaction entropy A.S. Note: if you have not been given enough information to decide a sign, select the "unknown" option. reaction A B C observations This reaction is sporkaneous only above -22. °C. This reaction is spontaneous only below -25. °C. This reaction is endothermic. AH is As is conclusions AH is As is AH is AS is (pick one) B (pick one) B (pick one) B (pick one) B (pick one) B (pick one) B

Use the observations about each chemical reaction in the table below to decide the sign (positive or negative) of the reaction em reaction entropy A.S. Note: if you have not been given enough information to decide a sign, select the "unknown" option. reaction A B C observations This reaction is sporkaneous only above -22. °C. This reaction is spontaneous only below -25. °C. This reaction is endothermic. AH is As is conclusions AH is As is AH is AS is (pick one) B (pick one) B (pick one) B (pick one) B (pick one) B (pick one) B

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter13: Spontaneous Processes And Thermodynamic Equilibrium

Section: Chapter Questions

Problem 62AP

See similar textbooks

Similar questions

The reaction CO2(g)+H2(g)CO(g)+H2O(g) is not spontaneous at room temperature but becomes spontaneous at a much higher temperature. What can you conclude from this about the signs of H and S , assuming that the enthalpy and entropy changes are not greatly affected by the temperature change? Explain your reasoning.
The deciding factor on why HF is a weak acid and not a strong acid like the other hydrogen halides is entropy. What occurs when HF dissociates in water as compared to the other hydrogen halides?
The deciding factor on why HF is a weak acid and not a strong acid like the other hydrogen halides is entropy. What occurs when HF dissociates in water as compared to the other hydrogen halides?
Consider two processes: sublimation of I2(s) and melting of I2(s) (Note: the latter process can occur at the same temperature but somewhat higher pressure). I2(s)I2(g)I2(s)I2(l) Is S positive or negative in these processes? In which of the processes will the magnitude of the entropy change be greater?
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25°C (b) NaCl(s)NaCl(l) at 25°C (c) 2NaCl(s)2Na(s)+Cl2(g) (d) CO2(g)C(s)+O2(g)
For the reaction CH3OH(l)+32O2(g)2H2O(l)+CO2(g) the value of G is 702.2 kJ at 25C. Other data are as follows: Hf (kJ/mol) at 25C S (J/molK) at 25C CH3OH(l) 238.7 126.8 H2O(l) 285.8 70.0 CO2(g) 393.5 213.7 Calculate the standard entropy, S, per mole of O2(g).
Given that H f for HF(aq) is -320.1 kJ/mol and S for HF(aq) is 88.7 J/mol K, find Ka for HF at 25C.
Quartz, SiO2(s), does not spontaneously decompose to siliconand oxygen at 25°C, 1.0 atm in the reaction SiO2(s)Si(s)+O2(g) even though the standard entropy change of the reactionis large and positive (S=+182.02JK1). Explain.
Limestone is predominantly CaCO3, which can undergo the reaction CaCO3(s)CaO(s)+CO2(g). We know from experience that this reaction is not spontaneous, yet S for the reaction is positive. How can the second law of thermodynamics explain that this reaction is not spontaneous?
Explain why absolute entropies can be measured.
At 1 atm, liquid water is heated above 100C. For this process, which of the following choices (iiv) is correct for Ssurr? S? Suniv? Explain each answer. i. greater than zero ii. less than zero iii. equal to zero iv. cannot be determined
What types of experiments can be carried out to determine whether a reaction is spontaneous? Does spontaneity have any relationship to the final equilibrium position of a reaction? Explain.