Write the electron configurations for each of the following elements and its ions:(a) Ti(b) Ti2+(c) Ti3+(d) Ti4+

Q: The DO3A ligand is an acyclic octadentate ligand with three N- donors and five O-donors. '

A: This statement is false  It has three N donar  but it has only four O donar atom .

Q: Explain reaction chemistry of CO with transition metals based on its Molecular orbital diagram?

A: Solution: Simply for any ligand to bind with transition metal required lone pair.  Let us know the…

Q: Which of the following is not isoelectronic with the rest? * O [PtCI,(n²-C,H,)I [(n²-C,H)Fe(CO). F O…

A: Complexes posses same number of electrons are known as isoelectronic species.

Q: What is the electron configuration of the complex [Co(NH3)6]3+? How do you determine this?

A: The atomic number of the Cobalt is 27The electronic configuration of Cobalt is

Q: Determine the charge of the metal center in diaquadibromoplatinum, [Pt(H2O)2Br2] a. Draw the…

A: The given complex is diaquadibromoplatinum, [Pt(H2O)2Br2]. In this complex, the central metal ion…

Q: True or false In the coordination compound [Mn(OH2)6]SO4, the complex cation is octahedral and…

A: Atomic number of Mn = 25 Atomic number of Pt = 78

Q: Determine the charge of the metal center in tetraamminedichloroiron, [Fe(NH3)4Cl2] a. draw the…

A:

Q: Determine the charge of the metal centre in tetraamminedichloroiron, [Fe(NH3)4Cl2] . a.Draw the…

A:

Q: The complexes [V(H2O)6]3+ and [VF6]3- are both known. What gives rise to the colors of these…

A: The striking colors exhibited by the complexes are caused due to excitation of an electron from…

Q: In the chemical reaction of Na2CO3 + Pb(NO3)2, the resulting product is ___________?

A: It is an example of double decomposition reaction as precipitation reaction  All salts of nitrate…

Q: For each of the following molecules or polyatomic ions, draw the Lewis structure and indicate if it…

A: Lewis structures are the representation of the chemical compound, which shows the sharing of…

Q: The coordination complex [Cr(CO)6] forms colorless, diamagnetic crystals that melt at 90 °C. Given…

A:

Q: • Give the formulas of these coordination complexes: • a. Tris(acetylacetonato)iron(III) • b.…

A: as per our guidelines we are supposed to answer only 3 sub- parts. Please repost others. a.…

Q: Draw the structure of the complex, [Ni(NH3)6][BF4]2, including approximate bond angles (in °).…

A: The objective of the question is to draw the given complex and write the angle and geometry.

Q: For the low-spin coordination compound [Fe(en)2Cl2]Cl, identify the following.(a) the oxidation…

A: Since you have posted questions with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: Which of the following is a π-donor ligand О со OPPh3 O Br O CN- The coordination number of Hg…

A: Transiston metal are those in which last electron enter the d-subshell.

Q: Draw the crystal-field energy-level diagrams and showthe placement of d electrons for each of the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Which element has the higher first ionization energy, Cu or Au?

A: The first ionization energy is the energy required to remove an electron from a neutral atom to form…

Q: What coordination isomer can be written for [Co(en)3][Cr(ox)3]?

A: Two coordination isomers are possible:- Answer [Co(en)3][Cr(ox)3] and [Cr(en)3][Co(ox)3] are the…

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

A: a) The given compound is [V(H2O)6]3+ The Oxidation state of ‘V’ is +3. The electronic configuration…

Q: Assign reason for each of the following :(i) Transition elements exhibit paramagnetic behaviour.(ii)…

A: Interpretation- To assign reason for each of the following-

Q: Explain the following statements : (ii) The presence of ligands can influence the impact of metal…

A: The heavy metals deposited in soil and aqueous environment creates a long term impact. The…

Q: Determine the charge of the metal center in diaquadibromoplatinum, [Pt(H2O)2Br2]. a.Draw the…

A: Geometrical isomers are the type of stereoisomers in which the species have same molecular formula…

Q: i. State TWO (2) characteristics of a o-donor ligand. By using one example, explain how to change a…

A: A sigma-donor ligand is a ligand that acts as a Lewis base donating electrons from a lone pair to…

Q: Draw the crystal field diagrams for [Fe(NO2)6]4− and [FeF6]3−. State whether each complex is high…

A: In coordination complexes, metal is present at the center of the complex and ligands surround it.…

Q: Write the formula for each of the following compounds, being sure to use brackets to indicate the…

A: In chemistry, the molecular formula represents the compound that is denoted by the element's symbol…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which there is a metal ion that forms coordinate bonds with…

Q: In the solid state, [Fe(CO)5] possesses a trigonal bipyramidal structure. Predict the mass spectrum…

A: Fe(CO)5+→Fe(CO)4+ →Fe(CO)3+ →Fe(CO)2+ →Fe(CO)+ → Fe+ m/z=195       167              139…

Q: Co+2 complexes are more stable than fe+2 complexes? Give reason

A: Interpretation -  To tell about why Co2+ complex are more stable than Fe2+ complex -…

Q: How many geometric isomers does the octahedral coordination compound[Co(NH3)3Cl3] have?

A: Geometrical Isomerism in heteroleptic complexes due to different possible three dimensional spatial…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Generally in a coordination complex, a central metal atom (usually transition metal) is bonded to…

Q: Among the following ligands, the ligand that is considered a chelating ligand is H20.a NH3.b O…

A:

Q: For each of the following pairs of complexes, identify the one that has the larger Crystal Field…

A: In both complex iron is in +3 oxidation state with electronic configuration [Ar] 3d5. H2O is a weak…

Q: The coordination complex [Cr(CO)6] forms colorless, diamagnetic crystals that melt at 90 °C. What is…

A: The oxidation number of chromium in Cr(CO)6 has to be given.

Q: Indicate the likely coordination number of the metal in each of the following complexes: (a)…

A: Coordination number is the sum of ligand atoms attached to the central atom. That means the ligands…

Q: Explain why transition metals exhibit multiple oxidation states insted of a single oxidation state?

A: Unlike main-group metals that tend to exhibit only one oxidation state, the transition metals often…

Q: Would it be better to use octahedral complexes of Cr3+ or Co3+ to determine whether a given ligand…

A: In order to decide the strength of ligands, the following factors have to check; The electronic…

Q: Palladium(II) tends to form complexes with coordination number 4. A compound has the composition…

A: The chemical compounds consisting of neutral molecules or anions attached to the central metal atom…

Q: Suggest a reason why copper(II) compounds are often colored but copper(I) compounds are colorless.

A: Given :  why copper(II) compounds are often colored but copper(I) compounds are colorless ?  To…

Q: For the hexacyanoferrate(III) ion, [Fe(CN)6]^3- calculate the crystal field stabilization energy…

A: Given : We have to calculate the CFSE for [Fe(CN)6]3- .

Q: What is the valence electron number and effective atomic number of the [CrCl3 (NH3) 3] coordination…

A:

Q: Write the IUPAC name of the following coordination compound [NiCl4]2-.

A: The given compound is [NiCl4]2-. It is an anion. Thus suffix 'ate' will be used. Calculation of…

Q: give an example of coordination compounds showing ionisation isomerism.

A: In ionization isomers ligand has exchanged places with an anion or neutral molecule that was…

Q: y8gngu. Amino acids can act as ligands toward transition metal ions. The simplest amino acid is…

A: Ligands are the electron donating neutral or anionic group that donates the atleast one electron…

Q: The coordination complex [Cr(CO)6] forms colorless,diamagnetic crystals that melt at 90 °C. (a) What…

A: (a)

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

A: (a)

Q: What is the balanced net ionic equation of NH3 reacting with Fe(NO3)3 and reacting with CuS

A:

Q: Write the formula for each of the following compounds, being sure to use brackets to indicate the…

A: Given compounds, (a) tetraaquadibromomanganese(III) perchlorate (b) bis(bipyridyl)cadmium(II)…

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.