Answered: Write the acidic ionization equation…

Science

Chemistry

Write the acidic ionization equation for HBr. Be sure to include the proper phases for all species within the reaction.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter15: Additional Aqueous Equilibria

Section: Chapter Questions

Problem 5QRT: Repeat the description for Question 4, but use a weak acid rather than a strong one.

See similar textbooks

Related questions

Q: Consider the following mechanism for the enzyme- catalyzed reaction: E + SES ES 2 E + P (fast…

A: Given, E + S ⇄k-1k1 ES {fast equilibrium }ES→k2 E+P {slow}

Q: Consider a tripeptide (a peptide that's only 3 amino acids long) composed of one molecule each of…

A: The amino acids present in the tripeptide are Lysine, Leucine, and Lupine. Lysine has a side -NH3+…

Q: Use the References to access important values if needed for this question. The wavelength of a…

Q: physical chemistry, please solve question 2

Q: Draw the organic product of the Lewis acid-base reaction shown below. Include all lone pairs and…

A: Given reaction: We have to draw the product of the reaction.

Q: Aspirin: LD so = 200. mg/kg (orally in rats) 1. For a toddler weighing 24.63 lb, the lethal dose of…

Q: The molar mass of glucose is 180.2 g/mol. How many grams of glucose will be produced when 132.0g of…

Q: CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2C…

A: CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2C…

Q: With the given data, calculate the enthalpy of hydration for both lithium chloride (LiCl) and sodium…

Q: Complete the following reaction by drawing the products or the reagents. Include stereochemistry…

A: In this question, we will draw the structure of the major product in first reaction and in the…

Q: Q12: Species that are formed in one step of reaction mechanism and used up in another step are…

A: Answer-12 Except a few elementary reactions most chemical reactions are complex reactions those take…

Q: Q15: Which of the following plots represents only base catalyzed reaction? a) Plot A b) Plot B c)…

A: 15. The given plot represents a graph between the logarithm of the rate constant of the reaction and…

Q: What are the name of these compounds and which one is a stronger acid? CH3CH2CH2NH3 or CH3CH2CH2OH2

A: Strong acids completely dissociate into their ions in water, while weak acids only partially…

Q: Which of the vinyl carbanions is capable of resonating with the carbonyl? Why and how? م محمد or

A: When carbanion take part in resonance and resonating structure is stable then resonance possible.…

Q: 1. You are given 70.0% (w/w) HNO3 solution. The density of this solution is 1.20 g/mL. Find the…

Q: 3. Ethyl acetate boils at 77.1oC. Butyl acetate boils at 1260C. Classify each of the fractions below…

A: The nature of solution can be determined from their boiling point range. Note : Since you have…

Q: Calculate mass (in grams) of Ca3(PO4)2 and of KCl that can be produced by mixing 5g of CaCl2 with 8g…

Q: Question The determination of Calcium in a 100 ml of natural water was done by precipitating the…

A: From the mass of CaO we can correlate it to concentration of concentration of calcium in water.

Q: 6. On what electrode and What mass (in gram) of chlorine gas could be released from a solution of…

Q: Calculate the number of moles in 21.50 grams of water?

Q: Suppose a 500. mL flask is filled with 1.3 mol of NO and 0.90 mol of NO2. The following reaction…

A: Given Volume = 500 ml = 0.5 L Equilibrium Constant K =0.720

Q: 2) Which of the following is a correct Fischer Projection for the molecule depicted in the box…

Q: Calculate the heat (q) for 195 grams of pure water heated from a temperature of 25.0 C to 77.5 C

Q: Among the given choices, select the five (5) beta blockers with Intrinsic Sympathomimetic Activity:…

A: Beta blockers with intrinsic sympathomimetic activity: The beta blockers with intrinsic…

Q: How does decreasing the total energy of the system affect the stability of the pair of atoms in the…

A: Decreasing the total energy of system of pair of atoms leads to stick them together. As bond formed…

Q: 1. Minimize Formal charge 2. Max amount of covalent bonds 3. Least separation of opposite charges 4.…

A: From the given options we have to arrange which is best suitable rules for the stability of a…

Q: Suppose a 500. mL flask is filled with 0.50 mol of CHC13, 0.30 mol of HCl and 0.40 mol of CC14. The…

Q: Upload an image that you found useful to explain the concept of pKa (acid dissociation constant),…

Q: Atom A Atom F NH Atom E HO Atom B Atom D H N F CH3 Atom C molecule 1

A: Functional group is atom or group of atoms which has special properties.

Q: 6. You're preparing a solution of a drug for IV administration. You dissolve the drug in a buffered…

A: Given the pH of the solution = 7.4 The initial concentration of the weak acid taken = 0.001 M…

Q: CI CI N

Q: When J. J. Thomson discovered the electron, what physical property of the electron did he measure?…

A: Millikan discovered the charge of an electron during his oil drop experiment.

Q: диться Y Beata a 11 H Ho H two bond will be Grohen. 4 0-10

A: Given is mass fragmentation reaction. This is Gamma hydrogen abstraction reaction known as Mac…

Q: Macmillan Learning Consider a general reaction A(aq) B(aq) The AG" of the reaction is -7.140 kJ.…

Q: . What is the chemical structure of biphenyl, circle functional groups different than alkane,…

A: Above questions can be explained as:

Q: Predict the reactants of this chemical reaction. That is, fill in the left side of the chemical…

Q: 3 Ci 3 7 7* 3 Li 3 7 7 +41 / + V. Vays (hu) how to calculate Q value of this nuclear reaction please…

Q: 1. Solve the following queries. Make sure you show full procedure using conversion factors if…

Q: You have a stock solution of 5% CaCl. For your experiment you need 250mL of a working solution of…

A: The equation used during dilution is M1×V1 =M2×V2 M1=initial concentration = 5% M2=final…

Q: Name each of the following compounds. CO₂H CH3 Br Gyu yle

A: IUPAC nomenclature of organic compounds is based on naming of the longest chain of carbons connected…

Q: 3. Discuss the physical properties of aliphatic hydrocarbons based on: a. Boiling and melting…

Q: Methane (CHA) burns in oxygen via the following reaction: CHa(g) + 202(8) > CO2(8) + 2H20(g) ; AH=…

A: The amount of energy absorbed or released in a chemical reaction is known as enthalpy of the…

Q: Specify all quantum numbers for the electrons in the 3p state in Zr. Do the same for the 4p state in…

A: #1: 3p subshell of Zr: 3p subshell has 3 orbitals that can accommodate 2 electrons each up to a…

Q: The percent by mass of NH3 in the solution is %.

Q: Q7: Calculate the mean activity coefficient as predicted by the Debye-Huckel Limiting Law (DHLL) for…

A: Question 7: Molarity of NaCl = 0.40 M Temperature = 298 K

Q: Rank the following structures in the order of INCREASING energy of nonbonding electrons. NO H I H…

Q: Draw the structures of each of the following compounds a. cis-1,2-Dichlorocyclopropane b.…

A: Here we are required to draw the structures of each of the following compounds a.…

Q: Part 2: How many electron shells (orbitals, clouds) does each element have around their nucleus in…

A: Here we have to write the number of elctron shells of the given atoms in neutral ground state .

Q: a solution is prepared by dissolving 49.3 g of KBr in enough water to form 473 mL of solution.…

Concept explainers

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red.

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.

Question

Write the acidic ionization equation for HBr. Be sure to include the proper phases for all species within the reaction.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Repeat the description for Question 4, but use a weak acid rather than a strong one.
Explain why equilibrium arrows are used in the ionization equations for some acids.
Aqueous Solutions of Acids, Bases, and Salts a For each of the following salts, write the reaction that occurs when it dissociates in water: NaCl(s), NaCN(s), KClO2(s), NH4NO3(s), KBr(aq), and NaF(s). b Consider each of the reactions that you wrote above, and identify the aqueous ions that could be proton donors (acids) or proton acceptors (bases). Briefly explain how you decided which ions to choose. c For each of the acids and bases that you identified in pan b, write the chemical reaction it can undergo in aqueous solution (its reaction with water). d Are there any reactions that you have written above that you anticipate will occur to such an extent that the pH of the solution will be affected? As pan of your answer, be sure to explain how you decided. e Assume that in each case above, 0.01 mol of the salt was dissolved in enough water at 25C to make 1.0 L of solution. In each case what additional information would you need in order to calculate the pH? If there are cases where no additional information is required, be sure to state that as well. f Say you take 0.01 mol of NH4CN and dissolve it in enough water at 25C to make 1.0 L of solution. Using chemical reactions and words, explain how you would go about determining what effect this salt will have on the pH of the solution. Be sure to list any additional information you would need to arrive at an answer.
. The concepts of acid-base equilibria were developed in this chapter for aqueous solutions (in aqueous solutions, water is the solvent and is intimately involved in the equilibria). However, the Brønsted-Lowry acid-base theory can be extended easily to other solvents. One such solvent that has been investigated in depth is liquid ammonia. NH3. a. Write a chemical equation indicating how HCl behaves as an acid in liquid ammonia. b. Write a chemical equation indicating how OH- behaves as a base in liquid ammonia.
What two common assumptions can simplify calculation of equilibrium concentrations in a solution of a weak base?
For oxyacids, how does acid strength depend on a. the strength of the bond to the acidic hydrogen atom? b. the electronegativity of the element bonded to the oxygen atom that bears the acidic hydrogen? c. the number of oxygen atoms? How does the strength of a conjugate base depend on these factors? What type of solution forms when a nonmetal oxide dissolves in water? Give an example of such an oxide. What type of solution forms when a metal oxide dissolves in water? Give an example of such an oxide.
Aluminum chloride, AlCl3, behaves more as a molecular compound than an ionic one. This is illustrated in its ability to form a fourth covalent bond with a chloride ion: AlCl3+ClAlCl4. From the Lewis diagram of the aluminum chloride molecule and the electron configuration of the chloride ion, show that this is an acidbase reaction in the Lewis sense, and identify the Lewis acid and the Lewis base. Aluminum chloride is a white solid at room conditions, although it is typically manufactured mixed with some yellow ironIII chloride. Its appearance is that of an ionic compound.
A solution has a pH of 7.0. What would be the color of the solution if each of the following indicators were added? (See Fig. 14-8.) a. thymol blue b. bromthymol blue c. methyl red d. crystal violet
Consider a solution prepared by mixing a weak acid HA and HCl. What are the major species? Explain what is occurring in solution. How would you calculate the pH? What if you added NaA to this solution? Then added NaOH?
A solution has a pH of 4.5. What would be the color of the solution if each of the following indicators were added? (See Fig. 14-8.) a. methyl orange b. alizarin c. bromcresol green d. phenolphthalein