Which one of the following reactions is spontaneous (in the direction given) under standard electrochemical conditions? O a. Mg2+ + 2Br → Mg + Br2 O b. 2Au + Pt2+ 2Au* + Pt O C. Pb2+ + 21 → Pb + 12 O d. 2Hg + 2CI + 2H* → Hg2Cl2 + H2 O e. Cu2+ + Fe → Cu + Fe2*

Which one of the following reactions is spontaneous (in the direction given) under standard electrochemical conditions? O a. Mg2+ + 2Br → Mg + Br2 O b. 2Au + Pt2+ 2Au* + Pt O C. Pb2+ + 21 → Pb + 12 O d. 2Hg + 2CI + 2H* → Hg2Cl2 + H2 O e. Cu2+ + Fe → Cu + Fe2*

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter8: Electrochemistry And Ionic Solutions

Section: Chapter Questions

Problem 8.10E: For each of the following reactions, determine the overall balanced electrochemical reaction, its...

See similar textbooks

Related questions

Q: The pH of a saturated solution of Mg(OH)2 is 10.45. What is the pH of the solution after the…

A: Given-> pH of Mg(OH)2 = 10.45 Volume of HCl = 250.0 ml = 0.250 L (1L = 1000 ml) Molarity of HCl…

Q: 3. Calculate cell voltages under the following conditions at 25°C: a) Zn Zn" (0.50 M)lCư (0.10 M)|Cu…

Q: You wish to construct an electrochemical cell from the following half- reactions: Ag* (ag) + e -->…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Consider these reactions: Reaction 1: H2(g)+Cl2(g)⟶2HCl(g)ΔH=−184.6 kJ Reaction 2:…

A: Change in enthalpy : ΔH = + 66.4 kJ ΔH = + 66400 J Change in…

Q: 4.At 298.15 K and 101.325 kP, Qy = %3D a 89 kJ•mol-1 in the reaction 2C(s) + 3H2(g) = C2H6(g), so…

Q: 2. A 0.696 mol sample of Cu is added to 136 ml of 6.0 M HNO,. Assuming the following reaction is the…

A: here we know that we are required to find whether Cu will completely react

Q: One or more of the monomers below are needed to make the polymer CN CN CN CHCH,CHCH,CHCH,- Choose…

A: The monomer which forms the given polymer = ?

Q: A 1.250 g sample of bauxite (the primary ore of aluminum) was analyzed for aluminum. The sample was…

A: Given: Weight of sample of bauxite = 1.250 g Mass of Al2O3 recovered =0.2890 g Mass of Ash = 0.0007…

Q: 1. What organic product would you expect from the reaction of compounds with excess ethylmagnesium…

Q: (CH 2)2 CH3 OCH 2- CCH2)5-CH2 cH3 C1H 2 CH 3 CH3-CH CH2 -- CHg 2 CH3 CH3 CH2-CH -CH2CH3 CH3-CH-CH3

A: Select the longest chain of carbon containing maximum number of substitutent groups. Numbering as…

Q: Draw the major product of the following reaction and enter its InChl code in the space provided.…

A: This is a nitration reaction, in this reaction nitronium ion generated from the nitrating mixture…

Q: How many moles of NO(g) can be produced in the reaction of 3.00 mol NH,(g) and 4.00 mol 0,(g)?…

Q: Use Woodward-Fieser rules to estimate the λmax for the following compound.

A: Woodward fieser's rule for conjugated dienes: Base value: Acyclic conjugated diene = 217 nm…

Q: The local weather forecaster reports that the current barometric pressure is 29.4 inches of mercury.…

A: Given : pressure = 29.4 inHg To convert : given pressure in atm

Q: 5. At a given temperature the vapor pressures of benzene and toluene are 183 mm Hg and 59.2 mm Hg,…

A: Given Vapour pressure pbenzene = 183 mm Hg ptoluene = 59.2 mm Hg Mole fraction Xbenzene = 0.620…

Q: HCONHCH2CH2CH3.

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)

Q: The volume of water needed to dissolve 0.0691 grams of calcium chromate is L. Assume no volume…

Q: In the reactions at 298.15K (1) C(diamond)+O2(g)-CO2(g) 4,H,=-395.4kJ.mol. (2)…

A: According to Hess's law change of enthalpy in a chemical reaction is same regardless of whether the…

Q: Calculate the mass defect of 19 9F Use 18.9984 amu as the actual mass of 19 9F

A: Given, Mass of 919F= 18.9984 amu mass defect = ?

Q: The chemical environment of protons can be deduced from their chemical shifts. What are the relative…

Q: Determine the pOH of a solution that is 0.110 M in CO3?-. For carbonic acid (H2CO3), Kal = 4.3 x…

A: B.) CO32- is a second conjugate base of H2CO3. So to calculate it's pOH , we would need its Kb1 ,…

Q: You wish to prepare a solution that is 12% sodium chloride by mass How much sodium chloride is…

A: Given :- % (w/w) of NaCl solution = 12 % Mass of solution = 2.0 kg To calculate :- Mass of NaCl…

Q: Balance the following oxidation-reduction reaction as if it were to occur in a basic solution. I(aq)…

A: A redox reaction is balanced by balancing the mass and charge. Hence the number of atoms of all the…

Q: Build a titration curve for the following scenarios. Make sure to label your accesses and any other…

A: Titration curve is formed by plot of pH of analytes vs volume of titrants as the reaction proceeds.

Q: A 16.2 g sample of a gas occupies 1.80 L at 756 torr and 25.0 °C. a) What is the formula mass of…

A: Given :- Mass of sample of gas = 16.2 g Volume = 1.80 L Pressure = 756 torr Temperature = 25.0°C…

Q: 1. Which is statement is INCORRECT? a. An oxidation-reduction reaction is any chemical reaction in…

Q: Determine the molar solubility for BaCOs (Ksp = 5.0 × 10-º) in a solution that already contains 1.4…

A: The solubility product of a sparingly soluble salt is called its Ksp.

Q: What is the major organic product of the following reactions

A: In this question we have to tell the product of the reaction.

Q: - explain briefly and shortly Proteinogenic amino acids and give examples - explain briefly and…

A: 1) Proteiogenic amino acids- These amino acids are the ones which create proteins. The term…

Q: When a polar liquid displays a concave meniscus, what interparticle forces are acting? Compare and…

A: In concave meniscus adhesion forces are acting and in context Cohesion is acting .

Q: write lown adetaled mechanism fer the fallowing?

A: 1) The compound is said to be acidic in nature only when its conjugate base is stabilized by…

Q: If you had a protein X, which is a soluble enzyme found inside the peroxisome, and you wished to…

A: Proteins chain of amino acids which join together to form protein. Proteins are found in the…

Q: Suppose you prepared a sample of nitrogen and collected it over water at 20 °C at a total pressure…

Q: Which of the following substances has the largest molar entropy? Why? HCI (g) HCI (s) HCI (1) HBr…

A: Molar entropy is the randomness of a molecule.The molar entropy depends on the state of a molecule…

Q: For a gas, which two variables are directly proportional to each other (if all other conditions…

A: Ideal gas equation is as follows - PV = nRT If volume of the gas is constant and gas constant is…

Q: 8. Predict the geometries of H,S using the VSSPR method with the following steps Step 1) Draw the…

A: In the given molecule: H2S molecule Total no. Of electron pair = 4 No. Of bonding pair = 2 No. Of…

Q: Calculate Kp for the following reaction: * PCI,(g) + Cl,(g) = PCI,(g) K. = 1.67 (at 500. K)

A: Given: Kc = 1.67 Temperature = 500 K

Q: If E°cell for a redox reaction is negative, which of the following statements must be true? 1. AG°…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 2. A 0.696 mol sample of Cu is added to 136 ml of 6.0 M HNO3. Assuming the following reaction is the…

Q: 2. Consider the following equilibria: 2S0;(g) = 2S02(g) + O2(g) K.= 2.3 x 10-7 2NO;(g) = 2NO2(g) +…

A: Characteristics of equilibrium constant: If reaction is reversed equilibrium constant is…

Q: 5. Given the reaction 2 CO(g) + 0,(g) 2 CO(g), what is the effect of adding O, (g) to a…

A: According to le chatlier principle for a reaction is at equilibrium any change is done in reaction…

Q: Answ GA 20. Answ My C x C Write C The F C Whe x akeCovalentActivity.do?locator-assignment-take…

Q: Give a clear handwritten answer with explanation...give the mechanism of given bleow reaction.

Q: For the reaction 2IB1(g) I2(g) + Brz(g), K = 8.50 x 10-3 at 150 °C. If 0.300 mol of IBr is…

Q: Identify the conjugate acid-base pairs: (. ---) (a) CH;COOH(aq) + H2O() CH;COO2(aq) + H30-(aq) (b)…

Q: Draw the major organic product of the following reaction. CH;CH2CHCH2CH3 SOC2 OH • You do not have…

A: In this question we have to tell the product of the reaction.

Q: Which of the following is present at equilibrium when sodium nitrite is mixed with a strong acid,…

A: In this question, we will select the product species after reaction of sodium nitrite with strong…

Q: Alcohol aqueous solution can be regarded as ideal dilute solution at 370.26 K, the total vapor…

Q: An acid and water need to be combined.should you add acid to the water or wAter to the acid .…

A: Given statement is : An acid and water need to be combined, should you add acid to the water or…

Q: The Pauli Exclusion Principle tells us that no two electrons in an atom can have the same four…

A: For 3s orbital, possible value of each quantum number ?

Concept explainers

Potentiometric Titrations

Potentiometric titration is one of the important titration methods and is mainly carried out to characterize acid solutions. It follows a method similar to that of the normal titration technique, but the main difference is that there is no indicator used in the potentiometric titrations. Instead of using an indicator, electrodes are employed for monitoring the whole titration process. A scientist named Robert Behrend did the potentiometric titration for the first time, and it was done using the mercurous solution and potassium chloride.

Question

Which one of the following reactions is spontaneous (in the direction given) under standard electrochemical
conditions?
O a. Mg2+
+ 2Br
→ Mg + Br2
O b. 2Au + Pt2+ 2Au* + Pt
O C. Pb2+ + 21
→ Pb + 12
O d. 2Hg + 2CI + 2H* → Hg2Cl2 + H2
O e. Cu2+ + Fe → Cu + Fe2*

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?