Identify the following formulas as that of a carboxylic acid, an amide, an ester, or none of these. Drag the appropriate items to their respective bins. Give detailed Solution with explanation needed CH3OCH3 CH3COCH3 CH3COOCH2CH3 CH3CH2NH₂ CH3CH2CNH2 CH3CH2CONHCH3 CH3COOH CH3CNH2 Carboxylic acid Amide Ester Other functional group

Identify the following formulas as that of a carboxylic acid, an amide, an ester, or none of these. Drag the appropriate items to their respective bins. Give detailed Solution with explanation needed CH3OCH3 CH3COCH3 CH3COOCH2CH3 CH3CH2NH₂ CH3CH2CNH2 CH3CH2CONHCH3 CH3COOH CH3CNH2 Carboxylic acid Amide Ester Other functional group

Introduction to General, Organic and Biochemistry

11th Edition

ISBN:9781285869759

Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Publisher:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar Torres

Chapter16: Amines

Section: Chapter Questions

Problem 16.13P: 16-13 Classify each amino group as primary, secondary, or tertiary and as aliphatic or aromatic....

See similar textbooks

Similar questions

What steps would be used to synthesize an organic amine? Group of answer choices Ketone + oxidizing agent →carboxylic acid + ammonia →organic amine Alkene + acid → alcohol + ammonia →organic amine Ether + acid →ester + ammonia →organic amine Alkane + acid → alcohol + ammonia →organic amine Carboxylic acid + alcohol →ester + ammonia →organic amine Aldehyde + oxidizing agent →carboxylic acid + ammonia → organic amine
Give the IUPAC name for the following acid amide: 0 CH3CH2CH(CH3)CH2CH(CH3)CH2C NH2
Write the systematic (IUPAC) names for the amines. H,C-NH,
The presence of amides in living organisms is beneficial due its stability which results from being the least reactive carboxylic acid derivative. True or False
Name the following amide. N- N butyl N methyl butanamide N,N diethyl butanamide N ethyl N methyl butanamide O N,N dimethyl butanamide
Amines in aqueous solutions are less reactive than amines in gaseous solutions. Select one: O True O False
Which of the following compounds cannot form hydrogen bonds with wate O CH3-CH2-OH 0 1 CH3-C-OH 0 I CH3-C-0-CH3 O CH3-CH2-CH3 0 O) CH3-CH)-NH2 Question 55 Aniline is a(n) O cyclic amine with only single bonds O tertiary aromatic amine O primary aromatic amine O secondary aromatic amine five carbon amine
Acid Anhydride Amine Thiol Peroxide Nitrile Arene
Complete this table for different amine compounds. Chemical propylamine quaternary ammonium ion methylphenylamine Molecular formula C3H9N C₂H7N C5H13N C4H10N Structural formula (CH3)3N (CH3)2NH CH 3 I (CH₂) 11 | H3C(CH2) 11 -N-(CH₂)11CH3 NHCH3 (CH₂)11 CH3 CH3CH2CH2-NH-CH3 + Classification Tertiary Quaternary Tertiary Secondary
What is the product of the following neutralization reaction between an amine and an acid, as shown below? H CH3—N—CH₂ - CH3 ammonium bromide O ethylmethylamine bromide ethylmethylamine ethylmethylammonium bromide + HBr →
Which compound makes the strongest amine base? `N CH3 -N- 1 2 3 4 Select an answer and submit. For keyboard navigation, use the up/down arrow keys to select an answer. a Compound 1 b Compound 2 Compound 3 d Compound 4
Indicate whether the following statement is true or false. Aliphatic amines are more basic than ammonia, whereas aromatic amines are less basic than ammonia.RightFalse