Question 12Given the reaction:Cu + Ag+ - Cu+ + AgThe reacxtion is is assumed to be that (Cul+)=(Ag1+)=1.0M and T = 298 K. As the reaction proceeds, Cu1+=0.2 M while Ag1+=1.80M. This occur after one minute.What is EMF of the cell?normal expressionWhat is the E of the cell after one minute?normal expressionWhat is the Keg for this reaction?(Express in scientific notation, in this manner, ex. 1.25x10^+3All answers in 2 decimal places.Standard Reduction Potential Table (at 25°C, 101kPa, 1M)Half-ReactionvoltsLi +e-Li- 3.04Al*+ 3e+AlI-1.68Zn*2 + 20 →Zn-0.76Fe*2 + 2eFe-0.442H,0 + 20° → H, + 20HNi*2 + 2e+ NiPb*2 + 2e Pb2H* + 2e H2-0.41-0.26- 0.130.00Cu*2 + 2e+ CuCu* +e CuFe*+e Fe*20.340.520.77Ag* + e* +Ag0, + 4H*2 + 40 → 2H,0Br, + 2e+ 2Br0.800.821.07Cl, + 2e+ 2Cı1.36Au*3 + 3e+ Au1.52Weak Oxidizing Agents / Strong Reducing AgentsStrong Oxidizing Agents / Weak Reducing Agents

Answered: Image /qna-images/answer/994443ef-098c-4484-a95f-77a91acee165.jpg

Question 12 Given the reaction: Cu + Ag+ - Cu+ + Ag The reacxtion is is assumed to be that (Cul+)=(Ag1+)=1.0M and T = 298 K. As the reaction proceeds, Cu1+=0.2 M while Ag1+=1.80M. This occur after one minute. What is EMF of the cell? normal expression What is the E of the cell after one minute? normal expression What is the Keg for this reaction? (Express in scie ^+3 entific notation, in this manner, ex. 1.25x10 All answers in 2 decimal places. Standard Reduction Potential Table (at 25°C, 101kPa, 1M) Half-Reaction volts - 3.04 •1.68 Li +e LI Al*+ 3e+AlI Zn*2 + 20 + Zn Fe*2 + 2e" Fe -0.76 -0.44 2H,0 + 20° → H, + 20H Ni*2 + 2e + Ni Pb*2 + 2e+ Pb 2H* + 2e H2 Cu*2 + 20 Cu Cu* +e Cu Fe*+e Fe*2 -0.41 -0.26 -0.13 0.00 0.34 0.52 0.77 Ag* + e*+ Ag 0, + 4H*2 + 40 → 2H,0 Br, + 20→ 2Br Cl, + 20" → 2C1 0.80 0.82 1.07 1.36 Au*3 + 3e" → Au 1.52 Strong Oxidizing Agents / Weak Reducing Agents Weak Oxidizing Agents / Strong Reducing Agents

Question 12 Given the reaction: Cu + Ag+ - Cu+ + Ag The reacxtion is is assumed to be that (Cul+)=(Ag1+)=1.0M and T = 298 K. As the reaction proceeds, Cu1+=0.2 M while Ag1+=1.80M. This occur after one minute. What is EMF of the cell? normal expression What is the E of the cell after one minute? normal expression What is the Keg for this reaction? (Express in scie ^+3 entific notation, in this manner, ex. 1.25x10 All answers in 2 decimal places. Standard Reduction Potential Table (at 25°C, 101kPa, 1M) Half-Reaction volts - 3.04 •1.68 Li +e LI Al+ 3e+AlI Zn2 + 20 + Zn Fe2 + 2e" Fe -0.76 -0.44 2H,0 + 20° → H, + 20H Ni2 + 2e + Ni Pb2 + 2e+ Pb 2H + 2e H2 Cu2 + 20 Cu Cu +e Cu Fe+e Fe2 -0.41 -0.26 -0.13 0.00 0.34 0.52 0.77 Ag* + e+ Ag 0, + 4H2 + 40 → 2H,0 Br, + 20→ 2Br Cl, + 20" → 2C1 0.80 0.82 1.07 1.36 Au*3 + 3e" → Au 1.52 Strong Oxidizing Agents / Weak Reducing Agents Weak Oxidizing Agents / Strong Reducing Agents

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 105QAP: Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a)...

See similar textbooks

Similar questions

What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
Calculate E° for the following cells: (a) Ag|Ag+Sn4+,Sn2+|Pt (b) Al|Al3+Cu2+|Cu (c) Pt|Fe2+,Fe3+MnO4,Mn2+|Pt
What is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Use the following half-equations to write three spontaneous reactions. Justify your answers by calculating E° for the cells. 1. MnO4(aq)+8H+(aq)+5eMn2+(aq)+4H2OE=+1.512V 2. O2(g)+4H+(aq)+4e2H2OE=+1.229V 3. Co2+(aq)+2eCo(s)E=0.282V
Consider the following reaction at 25°C: O2(g)+4H+(aq)+4Cl(aq)2H2O+2Cl2(g) The [H+] is adjusted by adding a buffer that is 0.125 M in lactic acid (HLac) and 0.125 M in sodium lactate (NaLac). The pressure of both gases is 1.00 atm and [Cl-] is 0.200 M. (Kafor HLac is 1.4104 .) Will the cell function as a voltaic cell?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+