Draw a triacylglycerol (triglyceride) made from glycerol, myristic acid [CH3(CH2) 12COOH], palmitic acid [CH3(CH2)14 COOH], and oleic acid [CH3(CH2),CH=CH(CH2),COOH(cis)]. Place palmitic acid at the middle position. Cis/trans isometry is graded; it may help to draw hydrogen atoms associated with the carbon atoms of the double bond. Select Draw Templates More Erase C H о
Q: Please don't provide handwritten solution ...
A: Step 1:
Q: Predict the major product of the following reaction and draw the resonance structure(s) responsible…
A: The objective of the question is to predict the major product when nitric acid (HNO3) reacts with…
Q: PLease answer teh following chem quesiton
A:
Q: 2. a) Calculate the hard-sphere (HS) collision theory rate constant ks for the reaction NO(g) +…
A: The objective of the question is to calculate the hard-sphere collision theory rate constant (ks),…
Q: draw the structures of the pyrroles formed from the reaction of 2,5-hexanedione with…
A: The structures of the pyrroles formed from the reaction of 2,5-hexanedione with p-chloroaniline,…
Q: One of the triggering condition for a fusion of Coronovirus (COVID-19) with a human cell is an…
A: The inability to effectively dispose of CO2 from the bloodstream, referred to as respiration…
Q: 2. For the following mechanism questions, please refer to Chapter 8.10 in the Klein text for more…
A: The objective of the question is to understand the mechanism of formation of cis- and trans- isomers…
Q: Two enzymes, E1 and E2, respectively catalyze the conversion of A to B, and B to C in two reactions…
A: The objective of this question is to determine the steady-state concentrations in a series of…
Q: What role does acid play in the Fisher esterification?
A: Fischer esterification is a chemical reaction used to synthesize esters. In this reaction, an…
Q: Please note that "geometry" refers to the molecular or ionic geometry. The Lewis diagram for NICI2…
A: for better understanding study VSPER Theory there you will get the above formula and you can derive…
Q: Please provide an explanation with the answer
A: Step 1:According to CIP rule : Higher atomic number gets higher priority. For stereocenter 2,…
Q: Online teaching and +…
A: Step 1: Step 2: Step 3:
Q: Describe the energy in natural gas and the way in which it's converted to electrical energy?
A: Step 1: Natural gas is primarily composed of methane, with smaller amounts of other hydrocarbons…
Q: H+ (aq) + HCO2 (aq) -- H2CO (aq) + H2O(l) What is the equilibrium expression.
A: Step 1: The equilibrium expression represents the ratio of the concentrations of the products to the…
Q: Determine if the following is aromatic, antiaromatic or nonaromatic:
A: Step 1:For a Compound to be aromatic(i) It should be cyclic(ii) It should be planar(iii) It should…
Q: 6. Provide the major product and propose a reasonable mechanism for its formation by using curved…
A:
Q: In the reaaction Co(g) +2H2(g) -- CH3OH(g) K= .03. At equilibrium, concentration of CH3OH is .81…
A:
Q: Choose the best reagents to complete the following reaction.
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Draw the product of the reaction shown below at physiological pH (pH = 7.4). Ignore inorganic…
A: Step 1: Step 2: Step 3: Step 4:
Q: calculate the volume of methane provided by the bacterial breakdown of 2.43 kg of sugar at 282 K and…
A: Step 1: PV = nRTMethane (CH4) has a molar mass of approximately 16 g/mol.Given: Mass of sugar…
Q: 60.0 mL of 0.625 M HNO, is titrated by 0.200 M KOH. Calculate the pH of the acid solution before any…
A: First, let's write the chemical equation for the titration:HNO₃ + KOH → H₂O + KNO₃This equation…
Q: A solution contains 0.0430 M Ca2+ and 0.0970 M Ag+. If solid Na3PO4 is added to this mixture, which…
A: The objective of this question is to determine which of the phosphate species would precipitate…
Q: How does an amino acid react with ATP? The carboxyl group of the amino acid is a nucleophile…
A: The answer is: D. The carboxyl group of the amino acid is a nucleophile that attacks the…
Q: period 2, group 7 element symbol
A: Step 1:
Q: Show the synthesis of the following from benzene:
A: Thank you.
Q: how to synthesize this? b) NH2
A:
Q: 27. The current concentration of NOBr is 0.988 M, NO is 0.244 M, and Br2 is 1.11 M. What is the Q…
A:
Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. LDA 2. CH2CHCH2Br (1 equiv)
A:
Q: 2. A similar experiment is performed to determine the empirical formula of an oxide of copper, and…
A: Given: Mass of crucible, cover and copper sample = 21.53 g Mass of empty crucible with cover = 19.66…
Q: None
A:
Q: 24. Von Franz's work on alchemy focuses on: A) "The symbolic nature of alchemical texts and…
A: A) "The symbolic nature of alchemical texts and practices." is correct because:Marie-Louise von…
Q: Provide the mechanism for the saponification of the following compound with HCl used in the work up:…
A: Step 1: The reaction involves nucleophilic addition, elimination, deprotonation and acidic workup.…
Q: Draw all stereoisomers formed in the reaction shown. Use wedges and dashes for tetrahedral…
A: In this reaction, the ethanol is a polar protic solvent, and the chloride ion is a nucleophile. It…
Q: P4(S)+5O2(g)=2P2O5(s) If 5.00g of phosphorus is burned, what mass of oxygen does it combine with?
A: The objective of the question is to find out the mass of oxygen that combines with 5.00g of…
Q: Explain the methods of preparations of the following paints supported with video film from the…
A: The objective of the question is to find the method of preparation of decorative paints with…
Q: Given the following drugs in a urine specimen: Cocaine alkaloid Secobarbital (a derivative of…
A: Given the following drugs in a urine specimen:Cocaine alkaloidSecobarbital (a derivative of…
Q: lease propose a method to synthesize the following peptid: Leu.Gly.Ala (automated synthesis only)…
A: The objective of the question is to propose a method for synthesizing the peptide using automated…
Q: i dont want hand writting image
A: Step 1:Racemization occuring in this reaction:- Racemization- Racemization is a process that…
Q: Why are some elements metalloids
A: Step 1: Elements are classified as metalloids because they exhibit properties that are intermediate…
Q: Tc-99m sulfur colloid is to be reconstituted with 75 mCi Tc-99m pertechnetate, to be drawn from an…
A: The objective of the question is to find the volume of eluate and normal saline that should be added…
Q: Predict the major product formed when the compounds shown below react with each other under the…
A: Step 1:Given reaction in known as Diels-Alder reaction.The Diels-Alder reaction involves a diene and…
Q: To preview image Click Here + Assuming the pi-systems in the following structures are flat, indicate…
A: thanks
Q: Please answer the follwing chem question
A:
Q: You have two G’s and two temperatures. Use these to solve for H and S. TEMP1 - 296.57 K TEMP2 - 340…
A:
Q: Identify and provide an explanation distinguishing a qualitative and quantitative chemical analysis.…
A: Step 1:Qualitative :- Qualitative chemical analysis focuses on identifying the presence or absence…
Q: A sample of 2.30 mol of gas in a 10.00 L container is at 45.0 °C. What is the pressure of the gas? A…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Please don't provide handwritten solution.
A: The objective of the question is to determine the product and the complete mechanism for the…
Q: hich of the following substances has the largest absolute entropy at 300K? Group of answer…
A: Out of the given choices, NH3(g) (Ammonia gas) has the largest absolute entropy at 300K. Entropy is…
Q: Choose the best reagents to complete the following reactions.
A:
Q: Provide IUPAC name for the structure shown below N О
A: The molecule is a tertiary amide. It contains a 4-carbon chain as marked (1-4). So, the base name…
![Draw a triacylglycerol (triglyceride) made from glycerol, myristic acid [CH3(CH2) 12COOH], palmitic acid
[CH3(CH2)14 COOH], and oleic acid [CH3(CH2),CH=CH(CH2),COOH(cis)]. Place palmitic acid at the middle position.
Cis/trans isometry is graded; it may help to draw hydrogen atoms associated with the carbon atoms of the double bond.
Select
Draw
Templates
More
Erase
C
H
о](/v2/_next/image?url=https%3A%2F%2Fcontent.bartleby.com%2Fqna-images%2Fquestion%2Fc0aeacae-67a2-40b7-94fc-c98bd99df5a0%2F45995275-3082-4fa4-ad7f-8337d33e636a%2Femkyh28_processed.jpeg&w=3840&q=75)
Step by step
Solved in 2 steps with 2 images
- Which of the statements are true? Unsaturated fats have higher melting points than saturated fats. Fats that contain more saturated fatty acid residues than unsaturated fatty acid residues are more likely to be solid at room temperature. Triacylglycerols (triglycerides) are carboxylic acids. Unsaturated fats are more likely than saturated fats to be liquid at room temperature. Triacylglycerols (triglycerides) contain ester bonds.Draw a triacylglycerol (triglyceride) made from glycerol, myristic acid [CH₂(CH₂)2COOH], palmitic acid [CH₂(CH₂)₁4COOH], and oleic acid [CH₂(CH₂)₂CH=CH(CH₂),COOH(cis)] . Place palmitic acid at the middle position. Cis/trans isometry is graded; it may help to draw hydrogen atoms associated with the carbon atoms of the double bond. Incorrect What did I do wrong?A lipid has the following structure: CH2-O-CH2-(CH2)16CH3 0 CH-O-C-(CH2)4CH=CHCH2CH=CH(CH2)7CH3 0 || CH2-O-C-(CH2)4CH-CHCH2CH=CH(CH2)7CH3 Which of the statements are true or false about the structure above Both this structure and a wax contain one or more carboxyl groups This lipid and a prostaglandin can both be hydrolyzed in acid to create fatty acids This lipid and a thromboxane can both be hydrolyzed in base to produce soaps Both this lipid and a terpene can be very hydrophobic molecules Based on its structural similarity to other lipids, this lipid most likely functions as a membrane component Both this structure and a wax contain one or more ester bonds This lipid and an arachidonic acid both contain glycerol and hydrocarbon chains Based on its structural similarity to other lipids, this lipid most likely functions as an energy storage molecule Both this lipid and a terpene can contain isoprene This lipid and a leukotriene are both polyunsaturated molecules Both this structure…
- Arrange the fatty acids from highest melting point to lowest melting point. - CH3(CH2)10COOH - CH3(CH2)7CH=CH(CH2)7COOH - CH3(CH2)4(CH=CHCH2)4(CH2)2COOH - CH3(CH2)14COOH Select the statements about fatty acid melting points that are true. - A saturated fatty acid with a greater molar mass has a higher melting point than a saturated fatty acid with a lower molar mass. - A saturated fatty acid with a greater molar mass has a lower melting point than a saturated fatty acid with a lower molar mass. - A saturated fatty acid has a higher melting point than an unsaturated fatty acid. - A saturated fatty acid has a lower melting point than an unsaturated fatty acid.Classify each of the molecules in the table. molecule CH3 CH₂-CH=CH-CH₂-CH=CH-(CH₂)9 CH3-(CH₂) 10 i - OH CH3–CH2–CH=CH−(CH2)5 -OH O=O C-OH type of molecule (check all that apply) fatty acid monoglyceride diglyceride triglyceride saturated unsaturated monounsaturated polyunsaturated omega-3 omega-6 fatty acid monoglyceride diglyceride triglyceride saturated unsaturated monounsaturated polyunsaturated omega-3 omega-6 fatty acid monoglyceride diglyceride triglyceride saturated unsaturated monounsaturated polyunsaturated omega-3 omega-6Which of the following structures is a 20:2 (Δ11,16) fatty acid? a. CH3(CH2)9CH=CH(CH2)3CH=CH(CH2)2COOHb. CH3(CH2)2CH=CH(CH2)3CH=CH(CH2)9COOHc. CH3(CH2)10CH=CH(CH2)3CH=CHCH2COOHd. CH3CH2CH=CH(CH2)3CH=CH(CH2)10COOH
- V F2 # 3 E 80 F3 What is the difference between integral and peripheral proteins? $ 4 F4 R A) Integral proteins are required for the cell to function, while peripheral proteins are accessory. B) Integral proteins are found on the outside of the cell, while peripheral proteins are found on the inside of the cell. C) Integral proteins extend through the lipid bilayer, and peripheral proteins are just on the surface of the inside or outside of the cell. Question 11 of 19 D) Integral proteins are found on the inside of the cell, while peripheral proteins are found on the outside of the cell. E) Integral proteins are channel proteins and peripheral proteins act as enzymes. % 5 F5 T <6 MacBook Air F6 Y & 7 ♡ F7 U * 8 DII F8 1 ( - 9 F9 0 O F1021. Two fatty acids found in rapeseed oil are behenic acid and erucic acid. Both contain the same number (22) of carbon atoms. Behenic acid is saturated and erucic acid is monounsaturated. The abbreviated structural formula of erucic acid is CH, (CH,),CH=CH-(CH2)11COOH. (a) Deduce the abbreviated structural formula for behenic acid 4 b) Explain why the melting point of erucic acid is lower than that of behenic acid 22. A cell membrane can vary in terms of how "fluid" or "flexible" it is. Describe if you would expect each of the following changes to make a particular membrane more fluid or more rigid. Explain your choices. a) An increase in the cholesterol content b) An increase in the fraction of unsaturated fatty acyl tails in the membrane phospholipids.Classify each of the molecules in the table. molecule CH3CH₂CH=CH-CH₂-CH=CH (CH₂)6 O || C-OH CH3 CH₂-CH=CH-CH₂-CH=CH-(CH₂)4 —CH=CH—(CH₂)3 - CH3 - (CH₂)5 C-OH C-OH type of molecule (check all that apply) fatty acid monoglyceride diglyceride triglyceride saturated unsaturated monounsaturated polyunsaturated w-3 w-6 fatty acid monoglyceride diglyceride triglyceride saturated unsaturated monounsaturated polyunsaturated w-3 w-6 fatty acid monoglyceride diglyceride triglyceride saturated unsaturated monounsaturated polyunsaturated w-3 w-6
- Which compound will yield a positive result with Salkowski test? * он Он Он H3C CH, OCH, но, А B OH OH он он но OCH, `CH3 он он он но HO D OH но O A Ов O D4. The ester you drew in Question #1 has a melting point range of 32 - 35 °C. The methyl ester of mono-unsaturated palmitoleic acid (IUPAC name: hexadec-9-enoic acid) has a considerably lower melting point range: -0.5-+0.5 °C. a) Explain what it means for a fatty acid to be "mono-unsaturated." b) Illustrate your explanation by drawing the structure of the methyl ester of octadec-11-enoic acid. (Be sure to draw the geometric stereoisomer that is commonly found in nature.)e X 1. During the hydrogenation of a cis-linked unsaturated fat, it will always convert to a trans fat when using a catalyst such as Nickel. True or False 2. Triglycerides always have three fatty acid chains linked to a glycerol group, and these fatty acids always have to have the same number of carbons in their
