Determine in the missing reagents needed to complete each reaction:

Q: 2) Give the IUPAC name for the major product of the reactic CH3 C-C-OH HC) CH3

A: 3° alcohol in presence of HX(X=Halogen) undergo substitution reaction to give an alkyl halide.  In…

Q: NAOH heat ?

A:

Q: What β-keto ester is formed when each ester is used in a Claisen reaction?

A: Claisen reaction is somewhat similar to the aldol condensation reaction. In this reaction the base…

Q: Which reagent will convert pent-2-yne to pent-2,3-dione.?     KMnO4, neutral and aqueous     1)…

A: Answer

Q: What products are formed when each compound is treated with aqueous acid? OH OCH3 HỌ HOÇH2 NHCH,CH3…

A: When carbohydrates react with acid, then esterification takes place. Reaction of the hydroxyl groups…

Q: What is required to complete the following reaction? O NaOH/H₂0 O 1) PPH3 CH2 2)NaBH4 O 1) CH3MgBr.,…

A:

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H* + H,0 ?

A:

Q: What is the major product of the given reaction? 1) CH₂Mgl CH PHO

A:

Q: Identify reagents that can be used to

A:

Q: Draw the products formed when each alcohol is dehydrated with H 2SO 4. Use the Zaitsev rule to…

A: Hello. Since your question has multiple subparts, we will solve the first three sub-parts for you.…

Q: -CH3 1. Hg(OАc)2, Н,о 2. NABH,

A:

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: % Yield of the reaction is a measure of reaction efficiency in terms of the amount of product formed…

Q: Draw the products formed when propan-2-ol [(CH3)2CHOH], the main ingredient in rubbing alcohol, is…

A: The given compound is propan-2-ol. The given reagent is NaH, H2SO4 and Li+-N[CH(CH3)2]2.   Since we…

Q: Give the structure corresponding to each IUPAC name. 2,4 dimethyl- 2 hexanol

A: The given compound is 2,4-dimethyl-2-hexanol.

Q: What steps are needed to convert ketone A to B and C?

A: Given reaction, Conversion of A to B and A to C.

Q: Draw the following compounds.  c. (Z)-2-methylpent-2-enol d. ethylpropanoate

A: First compound have hydroxy group as the functional group  Second compound has ester as the…

Q: Draw the products formed when each alkyl halide is treated with NaCN. а. b.

A:

Q: OH CH;CH,CHCHOCH,CH3 CH3

A: Applying definition of acetal and hemiacetal.

Q: 11. Draw all organic products from the following reaction. NaOH • H,0

A: Ester hydrolysis reaction: In the ester hydrolysis reaction, the ester is converted into carboxylic…

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C H* + H20

A:

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Write the IUPAC name of the main product that forms during the following reaction: :0: || .C. TCI…

A: The given structure is illustrated as follows: The name of the above compound is acetyl chloride.

Q: Rank the alcohols in order of increasing reactivity when dehydrated with H2SO4.

A: Generally, alcohols undergo dehydration reaction in presence of strong acids like H2SO4 or…

Q: What is the IUPAC name of the following compound? OH A. 4-methyl-5-penten-1-ol B.…

A: What is the IUPAC name of the given compound ?

Q: Which of the following alcohols can be prepared from a Grignard reagent and ethylene oxide? A. only…

A: From given  Initially the general structure of alcohol for the preparation of brothers reagent and…

Q: IUPAC name of the following compound is: CHO HO A 4-Hydroxycyclopentanecarbaldehyde…

A: Given that : We have to identify the IUPAC name of the following compound : A.…

Q: To obtain the specified product, what reagents should be reacted with the reactant?

A: In the given reaction the acid bromide reacts with a specific reducing agent and is reduced into an…

Q: choose the reagent which will differentiate the two compounds in pair

A: Hexane and 1-Hexene = This can be differentiated by using the Bromine water test. Bromine water…

Q: Write the IUPAC name and, where possible, a common name for each compound

A: The IUPAC name and common name for a given racemic mixture has to be given.

Q: What is required to complete the following reaction? H₂ H₂C CH₂ O 1) MCPBA 2) HCI O 1)NaOH 2) HC1 O…

A: MCPBA is meta-chloroperoxybenzoic acid.  It forms epoxide when react with alkene.

Q: Acetic Acid.

A:

Q: Which of the following is an acetal? H;C H;C но CH3 CH3 H;C- H3C H3C H3C OH C A and C B and D O A O…

A:

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C H* + H20…

A: We have to predict the IUPAC nomenclature of product formed.

Q: 3// When CH;COOH reacts with CH3-Mg-X formed?

A: Answer

Q: What is the product formed in the following reaction? H3C „CH3 NH:CH;/heat

A: Nucleophilic Addition Reaction In such reaction a nucleophile adds with an electrophilic centre. For…

Q: Which compound can undergo Cannizzaro reaction? CHO O CH;CHO H.

A: The base-induced disproportionation of two molecules of a non-enolizable aldehyde to yield a…

Q: Draw the products formed when phenol (C6H5OH) is treated with each set of reagents.a. [1] HNO3,…

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: What is the IUPAC name for the following structure? OH a) cyclohexenol b) 3-cyclohexen-1-ol c)…

A: According to IUPAC ,the prority of Alcohol is higher than the double bond,so alcohol will be here…

Q: What steps are needed to convert ketone A to B and C?

A: The steps needed to convert ketone A to B and C has to be given.

Q: Which reagents will accomplish this conversion?

A:

Q: Ts. CH3 NaOH heat `CH3 Peaction R

A: Nucleophilic substitution reactions are those reactions in which nucleophile attacks the alkyl…

Q: What reagent(s) are needed to complete the following reaction?

A: The given reaction is,

Q: Draw the neutral organic product when butanone reacts with one equivalent of ethanol in acidic…

A: Butanone + CH3CH2OH/HCl --->

Q: What unsaturated carbonyl compound is formed by dehydration of each β-hydroxy carbonyl compound?

A: Welcome to bartleby!

Q: What products are formed when each acetal is hydrolyzed with aqueous acid?

A: The reaction of an alcohol with aldehyde and ketone in the presence of acid produces acetal or…

Q: Reagents Product A Reagents 3 Reagents Product B Ph + Enantiomer

A: Step 1 : Allylic Bromination of cyclohexene. Step 2: Alkyl halide reaction with water (Sn1…

Q: Juestion Write the IUPAC name for each compound: сно CHO (a) (e) Question 2

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: Draw the products formed when phenol (C6H5OH) is treated with each set of reagents. a. [1] HNO3,…

A: The products formed when phenol is treated with given set of reagents has to be given.

Aromatic Compounds

Aromatic organic compound or aromatic system is an important class of hydrocarbons under the branch of organic chemistry. Aromatic compounds are also called arenas. The definition of aromatic organic compounds can be stated as a class of organic compounds with a planar cyclic ring of atoms bonded through alternated single and double bonds. Due to these alternating bonds, a peculiar feature termed as ‘resonance’, that is, delocalization of pi electrons or the electrons is shared within the atoms of the ring which are present in the aromatic compounds. The word ‘aromatic’ includes a Greek word ‘aroma’ which means smell, indicating that they were named as such due to the sweet odor they produce. Many well-known flavors such as vanilla, cinnamon, and few scents from flowers are extracted from aromatic compounds. Benzene with chemical formula C6H6 is a very common aromatic compound that contains six atoms of carbon held in the cyclic ring of alternate double bonds. It is also to be noted that not all aromatic compounds contain benzene ring. This can be explained by Huckel’s rule.