Q: (ii) Given that OH ar 7).- and that =C, au ar Show that Cp Cy=nRT for n moles of an ideal gas =C,
A: Change in enthalpy with respect to change in temperature at constant pressure is known as heat…
Q: 11. Given the following equilibria and equibrium constants: 1/2 N₂ (g) + 1/2 O₂ (g) NO (g) Kc = 4.8…
A:
Q: 2. Data for the reaction 2 HI (g) → H₂ (g) + I₂ (g) are given in the table below: Reaction…
A:
Q: Which of the following is not true about ATP? A) It is an energy storing molecule B) It is primary…
A: Adenosine triphosphate (ATP) is the source of energy for use and storage at the cellular level. The…
Q: Now, using the table of bond energies, calculate the enthalpy change for... CH3Br + OH --> CH3OH +…
A:
Q: Determine the average rate of change of B from t=0 s to 1 402 s. A 2B rates == M/s Time (s) 0 201…
A:
Q: The value of K, for ethylamine, C₂H5NH₂, is 4.30x104. Write the equation for the reaction that goes…
A: Kb is the base dissociation constant. How thoroughly a base breaks into its component ions in water…
Q: Determine the volume occupied by 0.582 moles of a gas at 15°C if the pressure is 622 mmHg.
A:
Q: A H ня B H H Д H D
A: ->Diels- alder reaction is an electrocyclic reaction ,which involves [4+2] cycloaddition of 4pi…
Q: 1. The rate constant for the first-order decomposition of a compound A in the reaction 3 A→P is kr =…
A:
Q: 1. Determine the percent composition by mass of all elements in Mn₂05. 2. Determine the percent by…
A: We have to calculate the percent composition of the given compounds
Q: СН3 CH3 СН3 .CI Br _CI чиз +NaNH, +KNH2 + NaNH, NH; NH₂ NH3
A:
Q: 5. Draw Lewis structures for each molecular formula. H A. C₂H4Cl₂ (two isomers) C-H--H-CI-CI A B.…
A: we have to draw the Lewis structures for the given formula
Q: 5. When a particle of mass 9.1 X 10-28 g in a certain one-dimensional box goes from the n = 5 level…
A: Since you have posted multiple questions, we will provide the solution only to the first question as…
Q: 9. a. Draw the molecule trans-1,3-butadiene, using any representation that shows the molecule's…
A: The structure of trans-1,3-butadiene and aspartame and IUPAC name of vinyl chloride is given below -…
Q: Enter your answer in the provided box. A gas initially at 4.67 L, 1.66 atm, and 66 °C undergoes a…
A: This is a simple question of calculation of final pressure using combined ideal gas law.
Q: In this unit, we started learning how to balance chemical equations. Engaging in this type of work…
A: 1. To provide the best explanation for why there is a need to balance the chemical equations in the…
Q: If 2.55 moles of H2 and 1.55 moles of 02 react how many moles of H2O can be produced in the reaction…
A:
Q: Look up on the chemical formulas/structures of the following fuel products. Show the balanced…
A: Combustion reaction : Combustion reaction is one type of chemical reaction in which hydrocarbons…
Q: Le Chateliers principles 7) + 3 Beg) веду A4 = +60,000 Inc [B]J Dec [D] Inc [C] = 2 Ccg +D (2) Inc I…
A: Given eqm rxn is 7A (s) + 3B (g) <=> 2C (g) + D (g) & ∆H = + 60000 where the positive…
Q: Which of the following is NOT an example of a reduction reaction? A) CH3-C-OH- B) CH3-C-CH3 --CH₂ L…
A:
Q: Н ОН OH (1) H2SO4 (2) H2O bicyclo[2.2.1]hept-2-en-endo-5,6-dicarboxylic acid CgH1004 m.p. = 203°C
A: Given reaction is Lactonization reaction Lactones are cyclic organic esters of hydroxycarboxylic…
Q: Calculate the concentrations of all species in a 0.510 M NaCH, COO (sodium acetate) solution. The…
A:
Q: 5. State the electron configuration, energy level diagram and element for the following: a) n = 6…
A: Outer most electronic configuration is given here.
Q: Using this table of ionization constants, calculate the overall equilibrium constant, Koverall for…
A: The given equilibrium is HCOOH(aq) +S2-(aq) ⇔HCOO-(aq) + HS-(aq) Koverall=HCOO- HS-HCOOH S2-
Q: The kinetics of a gas phase reaction of the form A → Products results in a rate constant of 1.308 M¹…
A: solve the question based on chemical kinetics given the rate of reaction and the initial…
Q: 12. The described electrochemical cell (concentration cell) was set up: Cu | CuSO4 (c1) || CuSO4…
A: The question is based on the concept of redox reactions reactions. Reactions in which…
Q: Give the major product for the following reaction. OH H₂CrO 4 H₂SO4 H₂O
A: Given alcohol is 3 degree alcohol generally 3 degree do not get oxidised not even by strong…
Q: Arrange the highlighted bonds in the table below in decreasing order of polarity. That is, pick 1…
A: The bond between atoms of different electronegativity is called the polar bond. Higher the…
Q: O Draw Lewis structure(s) for the nitrate lon (NO3). If there are equivalent resonance structures,…
A: A Lewis dot structure, also known as an electron dot structure or Lewis structure, is a diagram that…
Q: Calculate the PH and the the PH and the POH for a of Ca(OH)₂ -0091 M solution
A: The question is based on the concept of PH and pOH. pH is defined as negative logarithmic of…
Q: 3. Complete the following reactions: ? NaBH4 HIO4 OH OH DMP KMnO4 LIAIH4 OH Na2Cr2O7 PCC
A:
Q: What volume (in mL) of 0.2800 M HCl is required to neutralize 75.00mL of 0.6000 M LiOH?
A: Answer: This question is based on stoichiometric calculation where moles of LiOH needs be converted…
Q: Which of the following elements, when combined, would form a polar covalent bond? O F and H Cl and H…
A: Theory: Bond formed by atoms of different electronegativity is called a polar bond. Higher the…
Q: › Above what Fe²+ concentration will Fe(OH)₂ precipitate from a buffer solution that has a pH of…
A:
Q: I s it possible to carry out steam distillation at a temperature higher than 100C at 1 atm? Explain
A: In steam distillation, a mixture of two or more immiscible liquids is heated to vaporize the more…
Q: Be sure to answer all parts. A gas expands from 252 mL to 936 mL at a constant temperature.…
A: Given : V1 = 252 mL = 0.252 L = INITIAL VOLUME V2 = 936 mL = 0.936 L = FINAL VOLUME.…
Q: 5. Which of the following "isomeric" polymers would you expect to exhibit the greater crystallinity?…
A: Crystallinity of polymer is the amount of crystalline region in polymer . It depend on following…
Q: 3. Ammonium carbamate (NH₂COONH4) is found in the blood and urine of mammals, and decomposes in the…
A: Given: NH2COONH4 (s) - - - > 2NH3 (g) + CO2 (g) We need to find the total pressure in the…
Q: PART A. Freezing Point of Pure Lauric Acid 1. Mass of empty centrifuge tube + beaker Mass of lauric…
A: To solve questions no. 6, 7, and 8 based on the given information: Mass of unknown solute = 0.513 g…
Q: For the reaction below, Kc = 1.10 × 10-³. Note Kc is sometimes called K. What is the equilibrium…
A:
Q: Nitrogen forms a surprising number of compounds with oxygen. A number of these, often given the…
A: Given that, nitrogen trioxide is reacted with the oxygen gas to form the nitrogen dioxide and ozone…
Q: How many H atoms are in 77.1 g of isopropanol (rubbing alcohol), C3H8O? Enter your answer in…
A: Given: Mass of isopropanol = 77.1 g Molar mass of isopropanol = 60.1 g/mol
Q: 4. The rate law for the reaction H₂ (g) + I2 (g) → 2 HI (g) was determined to be rate = k [H₂] [1₂],…
A: The given reaction is- H2 g + I2 g → 2 HI gThe rate law for…
Q: Write the equations that represent the first and second ionization steps for tellurous acid (H₂TeO3)…
A:
Q: wavelength (m) 4.50 x 10-⁹ frequency (S-¹) 1.33 x 1015 wavenumber (cm-¹) 3215 energy (J) 7.20 ×…
A:
Q: In the electrolysis of an acid solution, oxygen can be produced by the following half-reaction:…
A:
Q: CaCO3 has the highest molar solubility in which one of the following solutions? A. 1.0 M NaOH B. 1.0…
A: The question is based on the concept of solutions. we need to identify the solution in which calcium…
Q: A concentrated solution has (more, less, some) solute than a (molar, concentrated, dilute,…
A: A solution is the mixture of solute and solvent. Its concentration is defined based on the amount of…
Q: the laboratory, a general chemistry student measured the pH of a 0.539 M ueous solution of…
A:
Reactions of Ethers
Ethers (R-O-R’) are compounds formed by replacing hydrogen atoms of an alcohol (R-OH compound) or a phenol (C6H5OH) by an aryl/ acyl group (functional group after removing single hydrogen from an aromatic ring). In this section, reaction, preparation and behavior of ethers are discussed in the context of organic chemistry.
Epoxides
Epoxides are a special class of cyclic ethers which are an important functional group in organic chemistry and generate reactive centers due to their unusual high reactivity. Due to their high reactivity, epoxides are considered to be toxic and mutagenic.
Williamson Ether Synthesis
An organic reaction in which an organohalide and a deprotonated alcohol forms ether is known as Williamson ether synthesis. Alexander Williamson developed the Williamson ether synthesis in 1850. The formation of ether in this synthesis is an SN2 reaction.
Solve all please
Step by step
Solved in 4 steps with 3 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?Dibenzalpropanone is a compound that can absorb UV rays and can be used as a sunscreen. Write down the reagents used to synthesize the compound dibenzalpropanone.
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Give IUPAC names for the following compounds:Alcohols undergo dehydration reactions in the presence of an acid catalyst. Which of the following compounds yields only a single alkene product upon dehydration?
- Draw the organic products formed when attached allylic alcohol A is treated with following reagent. [1] PBr3; [2] LiAlH4; [3] H2OMatch each reagent to the product that it forms. Multiple reagents may form the same product. нох Reagent Reagents SOCI2, pyridine: C CISO2CH3, pyridine: E HCI: A PCI 3: A A) B) "It "ft "bl H₂O D) E) F) پہلے علی علیہGive Introduction about Alcohols, ethers, and epoxides ?