Ammonia is a weak base that is a household cleaner and has a Kb =1.8 x 10-5. What is the pH of a 3.0 M solution of ammonia (NH3)?

Q: What is the pH of a 3.50 M solution of NH4CI (Ká of NH3= 1.8 x 105)?

A:

Q: Determine the pH of an aqueous solution that is 0.078 M in HCIO4 and 0.080 M in HNO3. O 1.5 O 0.98 O…

A: By using the formula of pH and by calculating total H+ concentration we can calculate pH.

Q: What is the pH of a solution with a [H3O*] concentration of 7.44 x 10-5 M?

A: Given: [H3O+] concentration = 7.44 × 10-5 M We have to calculate the pH of the solution.

Q: What is the pH of a 0.590 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: Find the pH of a 0.15 M solution of ammonia, NH3. Kb = 1.8 X 10-5

A:

Q: What is the pH of a 0.0520 M solution of HONH;CI (Kb of HONH2 is 1.1 x 10-8)?

A: HONH3Cl is a salt of weak base HONH2 and strong acid HCl Recall the following expression to…

Q: What is the pH of a 0.680 M solution of Ca(NO2)2 (Ka of HNO, is 4.5 x 104)?

A:

Q: Lactic acid, HC3H5O3, is found in sour milk. What is the pH of 0.30 M lactic acid? (Ka=1.4 x 10-4)

A: pH of a solution is the negative logarithm of hydronium ion concentration. It is a measure of…

Q: What is the pH of a 0.720 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: What is the pH of a 0.620 M solution of Ca(NO2)2 (Ka of HNO2 is 4.5 x 10 4)?

A:

Q: What is the pH of a 0.650 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: What is the pH of 3.7 x 103 M NH¼Br(aq)? Ο 10.4 O 2.4 Ο 11.7 O 5.8 O 4.6

A:

Q: What is the pH of a 0.0490 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A:

Q: What is the pH of 8.1 x 10-5 M HClO4 solution?

A:

Q: Calculate the pH of a 0.100M solution of the weak base NH3. Kb of NH3 1.8×10. %3D 3)

A:

Q: Calculate the pH of a 0.350M aqueous solution of NH3 , The Kb of NH3 is 1.77 x 10-5

A: Given: The concentration of aqueous NH3=0.350M

Q: What is the pH of a solution containing 0.30 M NH4OH and 0.52 M NH4Cl? Kb= 1.8 x10-5

A:

Q: Determine the pH of a 2.79 M solution of acetic acid (CH3COOH, ka=1.8x10-5)

A:

Q: What is the pH of a 0.150 M solution of acetic acid (pKa=4.75) at 25 degree celsius?

A: Given, the concentration of acetic acid =0.150 Mand pKa of acetic acid =4.75 at 25 °Cwe are asked to…

Q: 2. What is the pH, the pOH and the [OH] of a solution in which the [H*] = 2.43 x 10-6 M? %3!

A: pH is defined as  the negative log of hydrogen ion concentration  pOH is defined as the negative log…

Q: What is the pH of a 0.0338 M nitric acid, HNO3, solution?

A:

Q: A sample of calcium hydroxide (Ca(OH)2) has a concentration of 0.00473 mol/L. What is the pH of this…

A: The PH of Ca(OH)2 can be calculated as follows

Q: Calculate the pH of 0.10 M (COOH)½ (aq), oxalic acid. Ka1 = 5.9 x 10-² ; Ka2 = 6.4 x 10-5.

A:

Q: Calculate the pH of a 0.633 M NH, solution. NH, has a Kp 1.8 x 10–5.

A:

Q: What is the pH of 6.3 x 10-4 M Ba(OH)2 (aq)? Ο 11.1 O 10.8 O 3.2 O 2.9 O 7.6

A: We have to calculate the pH of 0.00063M Ba(OH)2 solution.

Q: Calculate the pH of an aqueous solution that has a hydronium ion concentration of 1.0 x 10^-3

A:

Q: Determine the hydronium ion concentration for a solution of 0.550 M Ca(OH)2.

A: Hii there, since there are multiple sub parts posted. We are answering first three sub parts. If you…

Q: What is the pH of a 0.510 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Given information: Concentration of solution = 0.510 M

Q: What is the pH of a 7.7 x 10-3 M HI solution?

A:

Q: Carbonic acid, H,CO3 is a diprotic acid with Ka1 = 4.3 × 10-7 and Ka2 = 5.6 x 10-1". What is the pH…

A:

Q: What is the pH of a 1.45 X 10-6 M solution of HNO3?

A: We have given that   Concentration of HNO3 = 1.45×10-6M  We know that  HNO3 is strong acid and…

Q: Determine the pH of a 0.100 M solution of HC₃H₅O₂ (Ka = 1.3 × 10⁻⁵).

A: The concentration of HC3H5O2 solution is 0.100 M. In the solution, HC3H5O2 (aq) ⇔H+ (aq) + C3H5O2-…

Q: The hydronium ion, HgOt, concentration in a sample of rainwater from a remote location is found to…

A: Given the hydronium ion concentration([H3O+]) of the rainwater sample at 25 oC  [H3O+] =  2.7*10-6 M…

Q: What is the pH of a 0.031 M solution of aqueous Sr(OH)2? 1.21 1.51 12.49 12.79

A: pH :-  The negative logarithm to the base 10 of hydrogen ion concentration expressed in mol/L of a…

Q: Determine the hydroxide ion concentration and pH of 0.0942 M hypochlorous acid solution. Ka = 2.85 x…

A: Concentration of hypochlorous acid (HOCl) solution = 0.0942 M Ka of HOCl = 2.85 * 10-8

Q: The following reaction is in equilibrium: NO2 (aq) + H20 (1) = HN02 (aq) + OH" (aq). Kh (NO,) = 2.2…

A: According to Le Chatelier's principle, when a system at equilibrium is disturbed, then the system…

Q: The pH for 0.050 M of CH3NH3Cl ?

A: Methylammonium chloride (CH3NH3Cl) dissociates into quaternary ammonium ion (CH3NH3+) and chloride…

Q: Calculate the pH of a 0.0200M solution of nitrous acid, HNO₂. Ka = 4.0 *10^-4

A: pH is commonly known as power of hydrogen, it is obtained by negative logarithm of hydrogen ion…

Q: M CH3COOH?

A:

Q: Find the pH of a 0.0015 M morphine solution (weak base), Kb = 1.6 x 10−6.

A:

Q: What is the pH of a 0.500 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: Calculate the pH of 0.17 M propanoic acid CH3CH2COOH, found in the sample analysis of sewage water.…

A: We have CH3CH2COOH →CH3CH2COO- + H+ Concentration of propanoic = 0.17 M  Ka=1.3 x 10-5

Q: What is the pH of a 0.0680 M solution of hydrocyanic acid, HCN (Ка %3D 4.9 х 10-10)?

A:

Q: Calculate the concentration of HCO3 in an aqueous solution of 0.1120 M carbonic acid, H,CO3 (aq).…

A:

Q: What is the pH of a 0.0245 M solution of NH3?        Kb = 1.8 x 10-5

A:

Q: A solution of vinegar corresponds to about 0.400 M. At this concentration, with Ka = 1.8 x10-5 ,…

A: Given: The concentration of vinegar solution = 0.400 M Ka = 1.8 x10-5 We have to calculate the pH of…

Q: What is the pH of a 0.01 M of the diprotic acid H2CO3 solution? Kai= 4.3 x 107; Ka2 = 4.8 x 10". %3D

A: We have given that  What is the pH of a 0.01M of the diprotic acid H2CO3 solution  Ka1 = 4.3 ×10-7…

Q: What is the pH of a 0.025M solution of sulfuric acid? Ka₂ = 1.2 x 10-² pH = [?]

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.