A 0.10 M FeSO:(aq) solution is electrolyzed between a magnesium cathode and a platinum anode with a current density of 1.0 mA cm2. The hydrogen overpotential is 0.65 V. What will be the concentration of Fe2+ ions when evolution of H2 just begins at the cathode? Assume all activity coefficients are unity. (E°(Fe2+/Fe)= -0.44V)

A 0.10 M FeSO:(aq) solution is electrolyzed between a magnesium cathode and a platinum anode with a current density of 1.0 mA cm2. The hydrogen overpotential is 0.65 V. What will be the concentration of Fe2+ ions when evolution of H2 just begins at the cathode? Assume all activity coefficients are unity. (E°(Fe2+/Fe)= -0.44V)

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.4QAP

See similar textbooks

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)