13.28 For the cell Pt,|Fe²*(a = 2.00), Fe**(a = 1.20); I"(a = 0.100)|1,(s)|Ptg %3D (a) write the cell reaction; (b) calculate E298 assuming the net liquid-junction potential is negligible. (c) Which terminal is at the higher potential? (d) When the cell is connected to a load, into which terminal do electrons flow from the load?

13.28 For the cell Pt,|Fe²*(a = 2.00), Fe**(a = 1.20); I"(a = 0.100)|1,(s)|Ptg %3D (a) write the cell reaction; (b) calculate E298 assuming the net liquid-junction potential is negligible. (c) Which terminal is at the higher potential? (d) When the cell is connected to a load, into which terminal do electrons flow from the load?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section20.5: Chromium

Problem 20.5PSP: At what pH does Ecell = 0.00 V for the reduction of dichromate by iodide ion in acid solution,...

See similar textbooks

Similar questions

The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
At what pH does Ecell = 0.00 V for the reduction of dichromate by iodide ion in acid solution, assuming standard-state concentrations of all species except H+ ion?
A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)