What is the IUPAC name of each of the the following? 0 NH₂ CH₂CH3 NHCHI CH₂CH3

Q: PROUDE THE MECHANISM BELOW THAT WIC LABEL IT FATHER AS AN E₂ OR E OH H₂0 HEAT

A: Given an alcohol, heat , water and acid.

Q: What is the IUPAC name for the following alkane? CH₂ CH₂ CH₂ CH₂ CH-CH3

A: IUPAC nomenclature of cycloalkanes:• Identify the longest continuous carbon ring• Identify the…

Q: Complete the following questions, clearly and neatly showing all your work. Give the name of the…

A: Organic compounds are compounds that contain carbon and hydrogen. In the given question it has been…

Q: Ph 1 2 3 4 Br NaCN 1. LIAIH4 2. HO Ph 1 Ph رسید NO2 3 NH Ph Ph 2 4 *NH2 NH2

A:

Q: Reaction of methyl-3-nitro-4-fluorobenzoate with morpholine LOCH3 LL NO₂ HN Methanol (solvent) ?

A: This is aromatic nucleophilic substitution reaction. In this reaction, morpholine act as nucleophile…

Q: A laboratory requires 2000 cm^3 of an antifreeze solution consisting of 30 mol % methanol in water.…

A: Partial molar volume of methanol (v1) = 38.632 cm3/molPartial molar volume of water (v2) = 38.632…

Q: Provide the major organic product(s) of the reaction shown below. NO₂ .CI NaNH,

A: Nucleophilic aromatic substitution involves the attack of a nucleophile on an aromatic ring and…

Q: Balance the following equation   653 kJ + PCl3 ---> P + Cl2

A: To balance the given equation:653 kJ + PCl3  P + Cl2

Q: 1. Assign a name to each of the following monosaccharides. Use D and L designations. H I CH 2OH C=O…

A: Carbohydrate having aldehyde functional group, is an aldoseCarbohydrate having ketonefunctional…

Q: Give the electron geometry (eg), molecular geometry (mg), and hybridization for Cl 3. O eg =…

A: The Formula for finding the hybridization number-Here the central Carbon atom has four valence…

Q: 1. Fill in the table with the missing information. Name Abbreviation One Letter Symbol Name…

A: Amino acids are groups of biomolecules.They are the basic building blocks of proteins. They are…

Q: Which statement about the factors that affect reaction rates is false? Decreasing the concentrations…

A: Chemical kinetics is branch of chemistry in which we deal with speed at which rate of reaction…

Q: The molar heat capacities for carbon dioxide at 298.0 K are shown below. C₁ = 28.95 J K ¹ mol-1 C₂ =…

A: Answer:First law of thermodyanics is based on energy conservation and it gives us relation between…

Q: What is the pH of the buffer that results when 2.3 g of NH3 and 6.46 g of NH4Cl are dissolved in 250…

A: To solve the above problem by means of the Henderson-Hasselbalch equation, the explanation is given…

Q: a) Using condensed structural diagrams, draw the polypeptide that is formed from the following amino…

A: given that-Three amino acid-Proline, Histidine, Arginine

Q: For an exothermic reaction, what does the activation energy of the reverse reaction equal? the…

A:

Q: Identify the class of lipid of the following molecule: O || CH3-(CH2)18-C-O-(CH2)19-CH3 steroid…

A:

Q: Classifying Salt Solutions as Acidic, Basic, or Neutral Determine whether the solution formed by…

A: If the neutralization reaction takes place between strong acid and strong base, a salt and unionized…

Q: Which of the following molecules is the most basic? NO₂ opp d 2 4 N 1 a) 1 b) 2 c) 3 d) 4 3 O e)…

A: In the given question we have to identify the most basic molecule in the following. First of all, we…

Q: The following reaction proceeds at a rate such that 8 mole of A is consumed per minute. Given this,…

A: Details

Q: 8. For each of the following amino acids, state whether the R group is polar, nonpolar or ionic. a.…

A: a. non-polarb. non-polarc. ionic d. polar

Q: D Question 2 Delocalized electrons are shared between 2 atoms. True O False

A: Electrons are two types    (1 )localized and(2) delocalised Localized electrons are present between…

Q: Br F F Name the following mc TI F LL F F

A: The IUPAC has set certain guidelines; hence the nomenclature of any compound must be carried out by…

Q: The Cs-131 nuclide has a half-life of 30 years. After 120 years, 3.0 g remain. What is the original…

A: Radioactive decay follows first-order kinetics. The half-life of the first-order reaction does not…

Q: The dissociation equilibrium constants for the protonated form of alanine (a diprotic amino acid…

A: Given that:Volume of alanine solution =  Volume of NaOH added = 100.00 mL​Concentration of alanine =…

Q: 1) HBr 2) NAOMe 3) mCPBA racemic

A: Markovnikov’s rule is a generalization that describes the outcome of some addition reactions in…

Q: Draw a clear scheme for the oxidative addition of H₂ to IrCl(PPh3)3, giving the oxidation state and…

A: We know that the oxidative addition of H-H on an organometallic complex increases both the oxidation…

Q: 6) Draw the product of the following reaction: & bom F₂C (1 eq)

A: Given compounds are substrate -  ketone and reagent - peracid.Generally ketones in presence of…

Q: (19, 10) Identify the mechanism by which each of the reactions above proceeds from among the…

A: When an electron-deficient species and a nucleophile combine to form a new molecule, the reaction is…

Q: Name the above compound CH CH

A: During the name of the organic compounds we have to follow IUPAC rules.

Q: Start with the total derivative of the internal energy, U, as a function of S and V, and use the…

A: Start with Total derivative of internal energy U, as a function of S and V, and Use First and Second…

Q: What is the reaction scheme of 2-methylhex-3-one to ethyl-n-butylamine

A: Aldehydes/ketones react with secondary amines to produce enamines.Enamines ==> Amines with a…

Q: Which of the following involve an increase in the entropy of the system under consideration? (Select…

A: Entropy is the measure of a system’s thermal energy per unit temperature that is unavailable for…

Q: 4. Balance the following equations by the redox method, include all the steps of the procedure.…

A: Step 1. Write down the -29c1-4ab9-867c-62d2d5ac22a3-0-0 style='text-decoration: underline; position:…

Q: The easiest fusion reaction to initiate is 2₁H + 3H₂He + ¹on Calculate the energy released, in kJ,…

A:

Q: 요. + 요슈액 H+ 1. DIBALH, -78 2. Ht, H2O 'NH2

A: These are the examples of Trans esterificationReduction ester to aldehyde by DIBALHConversion of…

Q: which compound have 9 protons expain Draw the structure.

A: The compound with 9 protons is to be found.Atoms are composed of a nucleus at the center, which…

Q: Calculate the amount of heat needed to melt 139. g of ice (H₂0) and bring it to a temperature of…

A: Given,

Q: The atomic molar mass of some elements, as shown in the periodic table, is as follows. Atomic molar…

A: moles of calcium = 3.00 molAtomic molar mass of calcium = 40.08 g/molmass of calcium = ?

Q: Calculate the "Third Law" entropy of CCl4 gas at 200 °C from the following data for CCL₂. o…

A: Given:Given the data: Calculate the "Third Law" entropy of , gas at 200 , Entropy is a state…

Q: Name this imine.  Does the NMR and IR match the following imine?

A: Here, we are given a molecule whose IUPAC name we have to find.We can name it as…

Q: 1. Determine the pH of a 0.0032 M KOH solution. Show your work. 2. Write the formula for the…

A: Given,The molarity of KOH = 0.0032 M The conjugate acid of H2PO3- is: The conjugate base of H2CO3…

Q: Q1. Consider the following reaction: 2 KMnO4(aq) + 3 H₂SO4(aq) + 5 H₂O2(aq) Complete the table below…

A: The rate of the formation of the product or the rate of disappearance of the reactants is known as…

Q: w would you synthesize the following compounds from butanoic acid using reagents from the table? e…

A: The following molecules are synthesized from butanoic acid by means of the above reagents.The above…

Q: 1. If for the reaction, the reaction is which of the following? b. a. 1 d. 4 a aX+bY → C e. 2 the…

A:

Q: 5.1 Identify and circle the leaving group 5.2 Assume that UDP-galactose reacts with glucose in SN2…

A: Given:Uridine diphosphate galactose (UDP-galactose)Identify and circle the leaving group Draw an…

Q: Draw the expected product for each of the following reaction: N NaOH H₂O A 1) MeMgBr (excess) 2) H₂O…

A: The given reactions are a example of nucleophilic addition reaction.

Q: multiple steps Br OH

A: As here we have to prepare a meta-substituted product, we must ensure that the second EAS step is…

Q: Predict the products when triacontyl hexadecanoate, a major component of beeswax is treated with…

A: When an ester is hydrolyzed, an alcohol and a carboxylic acid are formed.

Q: For numbers 24-25: A solution contains NaHCO3, Na2CO3, and NaOH, either alone or in a permissible…

A: The detailed solution for the given question is below.