(ii) (iii) CH₂OH Hy Pd/C (i) OH [ox] OH H,C 40 아 CH₂ CF3 Heat Br₂ CH₂C12 (iv) CH3 H₂C (v) H₂C он [0]

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1: Dear student I am eager to help you.In every legitimate and possible way but you forgot to…

Q: Give detailed Solution with explanation needed with structures. Don't give Handwritten answer

A: Step 1:Despite having chiral center when a compound has an element of symmetry then it gets turned…

Q: Calculate the mass of 2.6 x 1022 chlorine atoms in grams.a.4.4 gb.11 gc.0.76 gd.1.5 ge.3.2 g

A:

Q: After reviewing the reactions of glutamine formation on page 88 (old edition page 90), explain why…

A: Given: The formation of glutamine from glutamic acid and NH3 has a ΔG° of +3.4 kcal/mol, making it…

Q: 2. Use the atomic skeleton of a molecule below to answer the following questions. F FS F N₁ C₁-C2 H…

A: Valence electrons of a molecule can be calculated by the group member of each atom present molecule…

Q: 3) Consider the structures shown below and: a) Cross the ones that are not constitutional isomers…

A:

Q: Solve the following proporti (y)/(8)=(5)/(3) Round your answer to the ne

A: The problem is a proportion, which is an equation that states that two ratios are equal. In this…

Q: What    undergoes alpha decay to form Fr-273 In-123 undergoes electron capture to generate   what

A: In alpha decay, an atomic nucleus emits an alpha particle (consisting of 2 protons and 2 neutrons)…

Q: None

A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: The molecule shown in the image contains a carbonyl group (C=O) with an adjacent methylene group…

Q: 3. Prove that angular momentum of a particle confined to the xy palne is quantized 4. Neutrons have…

A: Question 3: Quantization of Angular Momentum in the xy PlaneTo prove that the angular momentum of a…

Q: Draw the energy level diagram which shows the effect of incorporating a ë-donor ligand into an…

A:

Q: Naming the parent hydrocarbon of branched alkanes For each organic compound in the table below, name…

A: Step 1: Step 2: Step 3: Step 4:

Q: Give correct detailed Solution with explanation needed of all options. don't give Handwritten…

A: Step-1 Bond mentioned is a double bond between carbon atoms. In the double bond, one bond is sigma…

Q: 2) An insulated container is used to hold 50.0 g of water at 25.0 °C. A sample of a new alloy…

A: Approach to solving the question:Please see attached photos for the detailed solutions. Thank you.…

Q: Chemistry

A: Given: C=20mg/L;M=158g/mol;ε=2100M−1cm−1Step 1: Write the Beer's Law equation.A=εbCA it is the…

Q: The symmetry of the metal d-orbitals that involve in sigma bond formation in octahedral complex…

A: Thank you.

Q: Predict the electron pair geometry and molecular geometry for the following substances by drawing…

A: The Lewis structure for BH3 is drawn by first writing the symbol for Boron (B) in the center, as it…

Q: Calculate the solubility at 25 °C of Ni(OH)2 in pure water and in a 0.0040 M NaOH solution. You'll…

A:

Q: Please correct answer and don't use hend raiting

A:

Q: An energy of 80.02eV is needed to ionize an electron from the ground state of a hydrogen- like atom.…

A: Step 1: Step 2:

Q: How is sodium enolate formed by adding NaOH to dimedone? What is the structure? Please include the…

A: Dimedone is a cyclic diketone, which means it has two carbonyl groups (C=O) in a six-membered ring.…

Q: Two moles of oxygen contained in the vessel A and two moles of hydrogen contained in the vessel B.…

A: The Ideal Gas Law is a fundamental principle in the study of physical chemistry, and it describes…

Q: Please help me solve the following question, explain and make sure everything is correct 100% thanks

A: Step 1: BeH2Number of valence electrons of Beryllium : 2 electrons.Number of valence electrons of…

Q: Part A The most common isotope of boron is ¹¹B. Determine the total binding energy of B using…

A: In order to determine the total binding energy of 511​B, we need to follow these step-by-step…

Q: An ideal-gas mixture contains 30% propane, 30% Neon and 40% Argon by volume at 2.00 atm absolute and…

A:

Q: Please answer in tipping format for

A: The pH of a solution is the negative logarithm of the hydrogen ion(H+) concentration.…

Q: What molar concentration of hydrazine, N2H4 (Kb = 1.7 x 10-6) yields a solution with a pH of 10.46?

A: First, we need to calculate the pOH of the solution. The pH and pOH of a solution are related by the…

Q: A reaction has a rate law of Rate = (1.25 M⁻²s⁻¹)[A][B]². What concentration of [B] would give the…

A: Step 1: 1. The given reaction is of the third order. Rate of reaction: It is the speed of reaction…

Q: Instructions: (1) You may use your class textbooks, handouts, and notes as you work on this problem…

A: The question asks for the synthesis of a specific molecule, which is a (Z)-alkene with a methoxy…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1: Step 2: Step 3: Step 4:

Q: Draw the major organic product(s) for the following. - You may assume each reaction occurs just one…

A: 1st step is Fridel craft acylation reaction where para product is formed as the substituted tertiary…

Q: (iii) Compound A is photostable in the crystalline solid state. Discuss how the solid-state…

A: Step 1:The photoreactivity of the compound can be increased if the ∏−∏∗ (pi to pi*) energy  gp is…

Q: 6) The reaction below shows how coal (carbon) can be converted to methane (natural gas): C(s)…

A: First, we need to calculate the change in enthalpy (∆H°) and the change in entropy (∆S°) for the…

Q: Calculate the molarity of each of the following solutions. Round each of your answers to 3…

A: Thank you,Please rate my response.

Q: None

A: To determine the hybridization state and molecular geometry of the indicated atoms in Enalapril, I…

Q: What is the AG for the following reaction (in kJ mol¹)? Cu₂O (s) Cu (s) + CuO (s) To solve, use…

A: The problem is asking for the Gibbs free energy change (ΔG) for the reaction Cu2O(s) -> Cu(s) +…

Q: Give detailed mechanism Solution with explanation needed..don't give Handwritten answer...

A:

Q: What is the Aldol condensation product for the following reaction? OH O cool.ntu.edu.tw NaOH

A: Thank you.

Q: Tooth enamel is composed of the mineral hydroxyapatite, Ca5(PO4)3OH which has a Ksp of 6.8 x 10-37.…

A: Step 1: Step 2: Step 3: Step 4:

Q: Cyclopentadiene H

A: Part 2: Explanation:Step 1: Identify the reactants and products.- Reactant: Cyclopentadiene (C₅H₆)-…

Q: Use half-reaction potentials to predict whether the following reaction are spontaneous or…

A: Given: T=298.15K2H2​S(g)​+O2(g)​→2H2​O(l)​+2S(s)​Step 1: Write the half-reaction. Include the H2O,…

Q: Chemistry

A: Chemistry is the branch of science that studies the properties, composition, and behavior of matter.…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Explanation : We know, unit conversion :1 km = 1000 m and 1 m = 100 cm  Therefore, 1 km = 1000 x 100…

Q: What acute reaction protein is rapidly gaining acceptance as an indicator of increased risk for AMI…

A: The question is asking about an acute reaction protein that is being increasingly recognized as an…

Q: Please be specific and explain why the compounds end up in that order. thank you

A: Step 1:For flask A, there will be no compounds present because all four compounds are dissolved in…

Q: 2. Identify the functional groups present in the following molecules. Molecule a. CH2CH3OH b.…

A: Step 1:A. This is an alcohol compound. We can see the hydroxyl bond -OH attached to an alkyl groupB.…

Q: When carbon is burned in air, it reacts with oxygen to form carbon dioxide. When 24.0 g of carbon…

A: Step 1:To determine the mass of carbon dioxide produced when 24.0g of carbon reacts with 81.6g of…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Reactants (A-B + C): Start at the initial energy level.First Transition State (TS1): The energy…

Q: write the steps in solving this using hess law. please show me the specific process

A: The target reaction is N2H4(l) + 2H2O2(l) -> N2(g) + 4H2O(l). We need to manipulate the given…