Calculate the ratio of CH3NH2 to CH3NH3Cl concentration required to create a buffer with pH = 10.16 (Kb = 4.4 x 104) Express the ratio to two significant figures. ▸ View Available Hint(s) Ο ΑΣΦ ? [CH3NH [CH3NH3C1] Submit Previous Answers X Incorrect; Try Again; 3 attempts remaining

Calculate the ratio of CH3NH2 to CH3NH3Cl concentration required to create a buffer with pH = 10.16 (Kb = 4.4 x 104) Express the ratio to two significant figures. ▸ View Available Hint(s) Ο ΑΣΦ ? [CH3NH [CH3NH3C1] Submit Previous Answers X Incorrect; Try Again; 3 attempts remaining

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter16: Reactions Between Acids And Bases

Section: Chapter Questions

Problem 16.52QE

See similar textbooks

Related questions

Q: Compute the volume that 6.46 kg of chlorine gas would occupy at standard temperature and pressure.…

A: mass of chlorine gas = 6.46 kg = 6460 gVolume of chlorine gas at STP = ?Note:molar mass of chlorine…

Q: From the solubility data given, calculate the solubility products for the following compounds. Part…

Q: If the potential for the following electrochemical cell is determined to be -0.525V SCE || Ag(CN)2…

A: To calculate the formation constant (Kf) for the reactionwe can use the Nernst equation: Where: - E…

Q: Provide the correct IUPAC name for the following compound Naz[Mn(SCN)2Br2(H2O)2] Give correct…

Q: 2. Our knowledge of chair conformations allows us to use them to determine a great deal about a…

A: The objective of this question is to analyze the given reaction products and determine whether…

Q: Consider the reaction between 2-methyl-2-butanol and HBr, shown below. HO HBr Br

A: Given that, the reaction is:

Q: Flame emission spectroscopy sometimes suffers from the difficulties of self-absorption and…

A: The objective of the question is to propose effective methods to overcome the challenges of…

Q: In making buffer 4, using disodium hydrogen phosphate (base) and 3.01g of potassium dihydrogen…

A: A buffer of disodium hydrogen phosphate (base) and 3.01g of potassium dihydrogen phosphate (acid) in…

Q: Predicting the qualitative acid-base properties of salts Consider the following data on some weak…

A: To answer this question, you need to understand the concept of conjugate acid-base pairs.A conjugate…

Q: Identify how many C (CARBON) atoms have sp hybridization for the compound below: :0: A B C 0 (zero)…

A: Identify the number of sp hybridized carbon atoms.

Q: Provide the structure for the dienophile necessary for the reaction below. + ?

A: Information about the question

Q: describe how to find the K of acetic acid from the pH measurements,

Q: ▾ Part A A 0.5880 g sample of impure magnesium hydroxide is dissolved in 102.0 mL of 0.2044 M HCl…

A: Molarity of HCl = 0.2044 mol/LMolarity of NaOH = 0.1039 mol/LMass of impure sample = 0.5880 gmolar…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. OH Na2Cr2O7 H2SO4, H2O Q

Q: The magnetic moment of divalent ion in aqueous solution if its atomic number 25 is

Q: 2. WHEN LOOKING AT THE CHEMICAL STRUCTURE OF SODIUM STEARATE, WHAT BIOLOGICAL MOLECULE DOES IT…

A: When examining the chemical structure of sodium stearate, it closely resembles a lipid molecule…

Q: Give the IUPAC name for the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH₂C NH2

A: Structure of acid amide:find out IUPAC name

Q: 24) Provide the structure of the major organic product(s) in the reaction H3C-CC-H 1. HgSO4, H2SO4…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: Which Newman projection represents correct conformation for the following compound: HO. H H A H3C…

A: To convert the given chair form to Newman projection

Q: Will nitration of compound D be slower or faster compared to nitration of benzene? NO2 OH A O faster…

A: In this question, we need to find out whether the rate of nitration of compound D will be faster or…

Q: what is the molarity of an aqueous solution that contains 0.0720 g of C2H6O2 per gram of solution.…

A: The objective of this question is to calculate the molarity of an aqueous solution of C2H6O2.…

Q: Order: ABC 1.5 g. Stock: ABC 2500 mg / 2 mL. How many mL will you give? O 1 mL 0.1 mL 0.6 mL 1.2 mL

Q: Predict the product of the reaction shown below. Br2, FeBr3 Give detailed Solution..don't ?give…

A: This is electrophilic aromatic substitution reaction.Lone pair on N in indole derivative take part…

Q: This molecule undergoes an SN2 mechanism. Provide the missing parts of the mechanism in the first…

A: Alcohol reacts with hydrohalic acid ( HCl , HBr and HI ) to form alkyl halides by SN1 or SN2…

Q: 22) Provide the structure of the major organic product(s) in the reaction below. HgSO4 H2SO4

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: (a) A 5.0 mL sample of 0.175 M methylamine CH3NH2 (Kb = 1.3 x 10-5) is titrated with 0.150 M HBr.…

A: The objective of this question is to calculate the pH at various points during the titration of a…

Q: A particular reactant decomposes with a half-life of 117 s when its initial concentration is 0.251…

A: The objective of this question is to determine the rate constant for a reaction given the half-life…

Q: Question 1. Indicate at which position(s) an electrophilic substitution will take place and justify…

A: To use the concept of electrophilic substitution reaction in the derivatives of benzene.Electron…

Q: 5. Cyclohexane can isomerize into methylcyclopentane, with an equilibrium constant of 0.12 at 25 °C.…

A: The objective of the question is to calculate the amount of cyclohexane that remains once…

Q: How many steps are in this reaction? Energy 1 2 3 4 + HC H Reaction coordinate H CI 7

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: The weak acid HZ has a Ka of 1.55 x 10-4. Calculate the pOH of 0.045 M HZ.

A: The required answer is given belowExplanation:Step 1:Step 2: Step 3: Step 4:

Q: A buffer solution is prepared by dissolving 1.50 g each of benzoic acid, HC7H5O2, and sodium…

A: The objective of this question is to calculate the pH of a buffer solution prepared by dissolving…

Q: 1. HNO3, H2SO4 NaNO2, HCI 2. Zn, HCI CF3 EtOH, 0°C

A: The benzene ring is electron-rich due to the presence of π electron cloud. Hence these compounds can…

Q: Question 4 Determine the position of equilibrium for the ACID-BASE reaction below: 0:- ? H A: ~…

A: Whether equilibrium lies on the right side or left side depends upon the acidity of the reactant and…

Q: Unanswered U8HW Question 14 Homework 11:59 PM Answered ⚫ Due Mar 19th, Submit How many grams of…

A: The yield is 11.3 grams of Ca(NO3)2Explanation:Step 1: Step 2: Step 3: Step 4:

Q: What are the products of the following hydrolysis? a primary amine and an aldehyde O a primary amine…

A: The objective of the question is to identify the products of hydrolysis when different types of…

Q: A first-order reaction has a rate constant of 0.00539 s half-life of the reactant? -1. If the…

A: Given:The reaction is of first-orderRate constant (K) = 0.00539 s-1Initial concentration = 2.50 MWe…

Q: Equilibrium and Reversible Reactions Part A. Name: PhET Equilibrium Inquiry Activity Learning Goals…

A: Overall after some time, we can see from the graph that the equilibrium state has been reached…

Q: Choose the best reagents to complete the following reaction. :(CH2OH)2, TSOH OH OH Q Q A NaOH B H2O…

A: Reaction:Reagent: Need to be determine

Q: 19) What is the relationship between the following compounds? Br A) enantiomers B) diastereomers C)…

A: Isomers are compounds that are identified to have the same molecular formula but differ either in…

Q: Which of the following is an empirical formula? P309

A: Compounds are composed of two or more than two different elements. We have been asked to choose the…

Q: In the provided boxes, provide synthetic sequences (including reagents used and the compound…

A: First anti Merkonikove addition of water to triple bond to produce enol which converted to aldehyde…

Q: What is the K for a base if a (2.0x10^-1) M solution has a pH of (1.18x10^1)? Report your answer to…

A: Given,Molarity of a base = 2.0 x 10-1 MpH of a solution = 1.18 x 101

Q: What is the strongest nucleophile in this list? B B OH D

A: A strong Nucleophilic easily donates its lone pair ( e- pair ) to electron deficient site.

Q: CI A B C HOCH 3 (solvent) D

A: The two reactants in organic chemistry combined to give the new product if the product formed is…

Q: Gaseous butane (CH3(CH2)2 CH3) reacts with gaseous oxygen gas (①2) to produce gaseous carbon dioxide…

A: The objective of this question is to calculate the theoretical yield of carbon dioxide (CO2) from…

Q: What is the pH of a 0.0820 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A: The objective of this question is to calculate the pH of a 0.0820 M solution of methylamine.…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. H 1. CHзMgBr 2. H3O+

A: Answer:Grignard reagent is an organometallic compound where carbon is bonded to Mg atom. That's why…

Q: Nitesh

A: Given temperatures areInitial temp = 20 °CFinal temp = 538 °CMelting point of Zn = 420 °CAt 20 °C,…

Q: Choose the expected final product (?) for the synthetic chain below: :0: H+ NH2 H₂O OA B O D…

A: Hydrolysis of amide to carboxylic acidConversion of -COOH to -COClReaction of -COCl with Gilman…

Concept explainers

Acid Base Titration

An acid-base titration is the method of quantitative analysis for determining the concentration of an acid and base by exactly neutralizing it with a standard solution of base or acid having known concentration.

Question

Sagar

Calculate the ratio of CH3NH2 to CH3NH3Cl concentration required to create a buffer with pH=10.16 (Kb = 4.4 x 104).
Express the ratio to two significant figures.
▸ View Available Hint(s)
ΜΕ ΑΣΦ
?
[CH3NH2
[CH3NH3C1]
Submit
Previous Answers
X Incorrect; Try Again; 3 attempts remaining

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: To determine

VIEW

Step 2: Determination of the ratio of CH3NH2 to CH3NH3Cl

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 6 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Sketch a pH curve for the titration of a weak acid (HA) with a strong base (NaOH). List the major species, and explain how you would go about calculating the pH of the solution at various points, including the halfway point and the equivalence point.
Calculate the pH after 0.010 mole of gaseous HCl is added to 250.0 mL of each of the following buffered solutions. a. 0.050 M NH3/0.15 M NH4Cl b. 0.50 M NH3/1.50 M NH4Cl Do the two original buffered solutions differ in their pH or their capacity? What advantage is there in having a buffer with a greater capacity?
When a diprotic acid. H2A. is titrated with NaOH, the protons on the diprotic acid are generally removed one at a time, resulting in a pH curve that has the following generic shape: a. Notice that the plot has essentially two titration curves. If the first equivalence point occurs at 100.0 mL NaOH added, what volume of NaOH added corresponds to the second equivalence point? b. For the following volumes of NaOH added, list the major species present after the OH reacts completely. i. 0 mL NaOH added ii. between 0 and 100.0 mL NaOH added iii. 100.0 mL NaOH added iv. between 100.0 and 200.0 mL NaOH added v. 200.0 mL NaOH added vi. after 200.0 mL NaOH added c. If die pH at 50.0 mL NaOH added is 4.0 and the pH at 150.0 mL NaOH added is 8.0, determine the values Ka and Ka. for the diprotic acid. d.
Calculate the pH after 0.15 mole of solid NaOH is added to 1.00 L of each of the following solutions: a. 0.050 M propanoic acid (HC3H5O2, Ka = 1.3 105) and 0.080 M sodium propanoate b. 0.50 M propanoic acid and 0.80 M sodium propanoate c. Is the solution in part a still a buffer solution after the NaOH has been added? Explain.
Sketch two pH curves, one for the titration of a weak acid with a strong base and one for a strong acid with a strong base. How are they similar? How are they different? Account for the similarities and the differences.
A good buffer generally contains relatively equal concentrations of weak acid and conjugate base. If you wanted to buffer a solution at pH = 4.00 or pH = 10.00, how would you decide which weak acidconjugate base or weak baseconjugate acid pair to use? The second characteristic of a good buffer is good buffering capacity. What is the capacity of a buffer? How do the following buffers differ in capacity? How do they differ in pH? 0.01 M acetic acid/0.01 M sodium acetate 0.1 M acetic acid/0.1 M sodium acetate 1.0 M acetic acid/1.0 M sodium acetate
Look at the titration curve below and determine what acid from the list could be the acid being titrated with NaOH. The black colored circle represents the equivalence point. O(A) HCNO Ka = 3.5 × 10-4 (B) H2C2O4 Ka = 5.9 × 10-2 (C) HCHO₂ Ka = 1.8 × 10-4 (D) HC (E) HN3 Ka = 1.9 × 10-5 pH 7.0 3.46 0 25 50 Submit volume NaOH added
2) How many moles of methylammonium chloride (CH;NH;CI) are needed to prepare a buffer that is pH 9.64 and contains 0.15 moles methylamine (CH;NH2)? pK», CH;NH2 =3.36 *Show calculations!*
What is the pH of a buffer prepared by adding 0.809 mol of the weak acid HA to 0.609 mol of NaA in 2.00 L of solution? The dissociation constant Ka of HA is 5.66 x 10¬?. Express the pH numerically to three decimal places. View Available Hint(s) pH = 6.124 %3D
Calculate the pH of the following buffer solutions:(A-) 10 mL 0.1 H3po4 + 25 mL 0.1 NaOH (B-) 10 mL 0.1 H3PO4 + 25 mL 0.1 Na3 PO4 (C- )A buffer solution pH=5.00 contains 0.01 M CH3 COOH.Calculate the concentration of sodium acetate it contains.(D- )What weight of NH4CI should be added to 1 L of 0.1 MNH3 solution to get pH=9.00?
A 300 mL buffer is prepared in which [HCO3- ] = 0.2 M and [CO32- ] 0.075M a) What is the pH of this buffer (Ka HCO3- = 4.7 x 10-11) ? b) What is the pH of the buffer if 0.0100 moles of HCl are added ? c) What is the pH of the buffer if 0.0200 moles of NaOH are added ?
What is the [CH3CO2-]/[CH3CO2H] ratio necessary to make a buffer solution with a pH of 4.44? Ka = 1.8 × 10-5 for CH3CO2H. A) 0.50:1 B) 0.94:1 C) 1.1:1 D) 2.0:1