A study of the acid shows that the pH of an acid HA O.12 MIK2.62. What is the K, of this acid?

Q: What is the pH of a .100M CH3COOH(aq) solution?

A: Acetic acid is a weak acid, it does not dissociate completely but exists in equilibrium with acetate…

Q: What is the pH of a 0.45 mol/L solution of hydrobromic acid? The answer should be to the proper…

A:

Q: What is the concentration of lithium ions in 0.395 M Li HPO,?

A: The volume of the solution remains constant. When Li2HPO4 dissolve, it gives rise to two moles of…

Q: The molar concentration of OH- in a water solution is 8.5× 10−12 M. What is the concentration of H+…

A: It is given that the concentration of OH- ions in water is 8.5×10-12 M,

Q: The pH of a solution containing a [H3O+] = 3.40 x 10 negative 5 M, is:

A: pH is a scale to measure the concentration of hydrogen ions. The negative logarithm of hydrogen ion…

Q: the pH of the solution. Be s

A:

Q: What is the pH of a 0.590 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: Write the reactions H2O/NAOH H;O/HCI NH | CH,OH/H*

A: The reaction of 2-Pyrrolidone with NaOH/H2O is shown below. The reaction of 2-Pyrrolidone with…

Q: It Senwater has a pH of 8.45, then what is the LOH]? ot

A:

Q: In a 2.31 M HCOOH aqueous solution, determine the percentage of ionised HCO0H molecules. K, = 1.8 x…

A:

Q: In a solution, [H+] = 1.54 x 10-2 M. What is its pH and is it considered an acid or a base?

A: Given is,  [H+] = 1.54 x 10-2 M

Q: why do you need to determine the concentration of the sodium hydroxide (NaH) using potassium…

A: Before using NaOH to determine the concentration of acetic acid in vinegar, we need to determine its…

Q: Suppose a 0.48M aqueous solution of phosphoric acid (H,PO,) is prepared. Calculate the equilibrium…

A: Given, Concentration of aqueous Phosphoric acid solution = 0.48 M     Required,…

Q: The pH of a solution is 5.2, what is the [OH] concentration?

A: Given pH of the solution = 5.2 In order to find [OH-] concentration, we have to calculate pOH from…

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: Define and describe the properties of acids and bases with respect to hydrogen ions?

A: The formation of salt and water takes place when acids and bases are reacted. Some of the examples…

Q: What is the pH of a 0.650 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: The pH of a lime is 1.90. What is the [H3O*]?

A: Power of hydrogenpH value indicates the acidic and basic nature of a solution. pH ranges between 0…

Q: Suppose a 0.031 Maqueous solution of phosphoric acid (H, PO) is prepared. Calculate the equilibrium…

A:

Q: e the pH of the solution. Be s

A:

Q: unat is The LOH Sampe of the ina Great salt e DHIS 0,25? lale if the

A: Solution :      pH is a quantitative measure that is used for hydroxyl ion concentration.It is…

Q: The odor of vinegar isdue to the presence of acetic acid.CH.COH, a weak acid Which of the following…

A: Given: Concentration of acetic acid in the solution = 1 M. And the solvent is water.

Q: An acid base reaction O a. Produces alkali and water and is exothermic

A: Neutralization Reaction :  The reaction in which a strong acid and a strong base reacts to form salt…

Q: What is the [H3O+] of tomato juice that has a pH of 4.10? Is it acidic or basic?

A: PH =-log10[H3O+]If PH < 7 then acidic    PH > 7 then basic

Q: the pH of an acid solution is 3.59. If the concentration of the acid in the solution is 0.200 mol/L,…

A: Given Concentration of the acid=0.2 mol/LpH of the acid solution=3.59Ka of thel acid=??

Q: What is the pH of a 1.47 mol/L solution of HCN(aq) if its Ka = 3.5 ´ 10-11?

A: HCN is a weak acid hence it can dissociate partially Ka value of HCN=3.5×10^-11

Q: What is the pH of a 0.870 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Answer:- This question is answered by using the simple concept of hydrolysis of the salt formed by…

Q: What concentration of barium hydroxide is needed to give an aqueous solution with a pOH of 1.240?…

A: Given, pOH = 1.240 of Ba(OH)2  To find Molarity = ?

Q: Determination Of The Acid Conent In Vinegar  -How would the concentration of the vinegar solution…

A: Please find your solution below : The acid content in vinegar can be easily determined by titrating…

Q: If 25.21mL of NaOH solution is required to react completely with 0.500g KHP,what is the molarity of…

A: Molarity (M) :-  The number of moles of solute dissolved in one litre of solution is defined as…

Q: A 0.751 molar solution of formic acid in water is prepared by a scientist. The Ka of formic acid is…

A: The ionisation reaction of formic acid is given as HCOOH ----> HCOO- + H+  Hence Ka = [HCOO-] X…

Q: Given that the pH is 10.285 What is the: [H3O+] pOH [OH-] Is it an acid or base?

A: It is given that the pH of a solution is 10.285 and the [H3O+], the pOH and [OH-] needs to be…

Q: What is the pH of a 0.510 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: Given information: Concentration of solution = 0.510 M

Q: Suppose a 0.48M aqueous solution of phosphoric acid (H,PO,) is prepared. Calculate the equilibrium…

A:

Q: -SO,Na СHCI; ? + КОН > ? +

A:

Q: What is the conjugate base of H,CO,?

A: An acid releases a proton in solution to form its conjugate base.

Q: What concentration of aqueous aluminum nitrate is required to produce a solution with a…

A: Given that, [NO3-]= 0.568 M then, [Al(NO3)3]=?

Q: What is the pH of a 0.380 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: of the strong base: NaOH? TYOUR ANSWER TO 3 NON ZERO DIGITS OF ACCURA PUT UNITS IN THE ANSWER BOX

A: Mmol of HCl = M × V   = 0.307 × 600 = 184.2 mmol Mmol of NaOH = M × V    = 0.156 × 230 = 35.88 mmol…

Q: Complete the following neutralization reaction between an acid and a base. Do not incluc not write…

A: Balance chemical equation is defined as which has equal number of atoms or ions in both sides…

Q: If the hydrogen ion concentration in a solution is 7.45x10^-3 mol/L then what is the pH ?

A:

Q: 8. LIOH (aq) CuCro, (aq) →

A: Complete and balanced the given reaction-- LiOH(aq) + CuCrO4(aq) ----> ? + ?

Q: How milliliters of 10.5 M HCI(aq) are needed to prepare 435.0 mL of 1.00 M HCI(aq)? many V =

A: The preparation of a dilute solution from a concentrated solution is known as the dilution. Molarity…

Q: What is the pH of a 0.500 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A:

Q: How many grams of LiC2H3O2 are needed to prepare 1.83 L of a solution that has an ion concentration…

A: Consider the given information is as follows; Volume of the solution = 1.83 L Concentration = 0.745…

Q: A student is planning an investigation of an acid-base reaction. Which of the following is not an…

A: Given Methods Are   pH meter Conductivity meter pH paper Visual Chemical indicator

Q: The formula for the conjugate acid of HPO42- is?   A student weighs out a 2.33 g sample of…

A: According Bronsted-Lowry acid and base theory, acids are substance which loses protons H+ to form…

Q: To what volume shauld I lomL of a 6,7M HCl salution be dilu ted t prepare a O.30M HCl Solution?

A: Here, we will use the formula : M1V1 = M2V2 M1 = Initial concentration V1= Initial volume M2 = Final…

Q: The [H3O+] of Coca-Cola Classic ® is 3.2 x 10-3. What is its pH? Is it acidic or basic?

A: The pH of the given solution can be defined as the measure of its basicity or the acidity. It is…

Q: the hydronium ion concentration of an aqueous salution of 0.468 M hydrofluoric acid (k₁ = 1·20X10²4)…

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.