Using the following balanced equation to the question that follows.1 Zn + 2 Mn0, + 1 H,0 → 1 Zn(OH)2 + 1 Mn203How many moles of MnO2 are needed to produce 4.58 moles of Zn(OH)2?9.16 moles398 moles4.58 moles797 moles

Answered: Image /qna-images/answer/2b35d215-aab2-4f94-ab65-6a6babfab81e.jpg

Answered: 1 Zn + 2 Mn02 + 1 H20 → 1Zn(0H)2 + 1…

1 Zn + 2 Mn02 + 1 H20 → 1Zn(0H)2 + 1 Mn2 How many moles of MnO2 are needed to produce 4.58 moles of Zn(OH)2? 9.16 moles 398 moles 4.58 moles 797 moles

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.23PAE: 4.23 In the reaction of arsenic with bromine, AsBr5 will form only when excess bromine is present....

See similar textbooks

Related questions

Q: What is the [H3O+] (molarity) of a 0.1452 M hydrazine? See reaction below N2H4 + H2O ↔ N2H5+ + OH-…

A: The Equilibrium Reaction given in the question is - N2H4 + H2O ↔ N2H5+ + OH- Then - Kb =…

Q: In the following reaction, what mass of Na will react exactly with 0.20 moles of water? 2Na(s) +…

A: The balanced chemical equation is given below.

Q: NaOH + 2AL -->2Na3 ALO3+3H2 how many miligrams of NaOH are required to produce 3.00 moles of…

Q: 2. Potassium chlorate, KClO3, is obtained by the action of chlorine on a hot potassium hydroxide…

A: The given chemical reaction is, KOH + Cl2 → KClO3 + KCl + H2O Chemical reaction is…

Q: Calculate the number of grams of AgNO3, required to react with the lead. Pb(s)+AgNO3(aq) ->…

A: The given equation is:Pb (s) + AgNO3 (aq) → Pb(NO3)2 (aq) + Ag(s)

Q: Which equation below is the balanced molecular equation for the reaction of potassium chloride with…

Q: How many moles of HCl are required to react with 18.2 g of Zn to form ZnCl2 and H2? a. 0.558 b. 73.0…

A: Given,

Q: Aluminum hydroxide reacts with sulfuric acid as follows:…

A: Given, the balanced chemical equation - 1) Now by using the given mole ratios, we will calculate…

Q: For the reaction: 6 Li(s) + N2(g) 2 Li3N(s) Determine: 1)the mass of N2needed to react with 0.536…

A: The relationship between moles, mass and molar mass is: Moles = MassMolar mass Applying this concept…

Q: 12) Calcium carbide (CaC2) reacts with water to produce acetylene (C2H2) as shown in the unbalanced…

A: The unbalanced reaction equation for the reaction of CaC2 and H2O is CaC2(s) + H2O(g) → Ca(OH)2 +…

Q: HNO₃ in the presence of excess water in the following chemical reaction? 3 NO₂(g) + H₂O (l) → 2…

A: According to the given balanced reaction 3 NO₂(g) + H₂O (l) → 2 HNO₃(g) + NO(g) we can say that 3…

Q: 1 Zn + 2 MnO2 + 1 H2O → 1 Zn(OH)2 + 1 Mn2O3 How many moles of Mn2O3 can be…

Q: According to the following reaction, how many moles of oxygen gas are necessary to form 0.295…

A: Solution : A combustion reaction is an irreversible reaction in which a compound reacts…

Q: H3PO4 + 3 Mg(OH)2 → Mg3(PO4)2 + 6 H2O (MM = 97.97) (MM = 58.32)…

A: Applying concept of limiting reagent and mole concept.

Q: PCI, + 4 H,0 H,PO, + 5 HCI 8. If you use 336 moles of water in an experiment, how many moles of…

A: Given balanced reaction, PCl5 + 4H2O → H3PO4 + 5HCl This is a balanced reaction in which one mole…

Q: 1. _NaOH +_Cu(NO3)2 → _Cu(OH)2 (s) + _NaNO3| When 25.00g of NaOH reacts with 25.00g Cu(NO3)2, how…

Q: What is the net ionic equation of the following molecular equation? K2SO3 (aq) + 2HCI (aq) → SO2 (g)…

A: We have given the molecular equation as follow K2SO3 (aq) + 2HCl(aq) → SO2 (g) +…

Q: A reaction mixture initially contains 0.25 moles of ZnS and 0.25 moles of O2. After the reaction is…

Q: How many grams of lithium nitrate will be needed to make 200.0 grams of lithium sulfate, assuming…

Q: What mass of NaCl is required to produce 78 g of AgCl? AGNO, + NaCl → AgCl + NANO, -> 3. 3.

A: Balanced Reaction AgNO3 + NaCl ----> AgCl + NaNO3 Mole ratio 1 mol NaCl = 1 mol AgCl Moles of…

Q: 7. According to the diagram below, which equation could correctly represent the reaction? 00 00 00 A…

A: Please find the solution below:

Q: 2C12H4Cl6+23O2+2H2O⟶24CO2+12HCl2C12H4Cl6+23O2+2H2O⟶24CO2+12HCl How many moles of water are needed…

A: Given, moles of O2 = 10.0 mol The given reaction is : 2 C12H4Cl6 + 23 O2 + 2 H2O -----> 24 CO2 +…

Q: Lead (II) carbonate decomposes to give lead (II) oxide and carbon dioxide: PbCO3 (s) → PbO (s) + CO₂…

A: Detail mathematical calculation is shown below

Q: What amount of O2 is needed to produce 4.23 mol of CO2 in the reaction CH4+2O2=CO2+2H2O 1.6.36 mol…

A: The balanced reaction taking place is given as, => CH4 + 2 O2 ------> CO2 + 2 H2O

Q: How many moles of O2 would be required to generate 13.0 mol of NO2 in the reaction below assuming…

A: The given reaction is, Actual mass of NO2 formed is calculated as follows,

Q: 4. If you dissolve lead (II) nitrate and potassium iodide in the water they will react to form…

Q: Which reaction equation for the combustion of hexane (C6H14 ) is correctly balanced? A C6 H14 + 902…

A: We have reaction of hexane with oxygen to give carbon dioxide and water. We have to predict the…

Q: In the following reaction, how many moles of oxygen gas are needed to produce 4 moles of Al2O3? 4 Al…

Q: Zn + 2MnO2 + 2H2O > Zn(OH)2 + 2MnO(OH) How many grams of zinc is needed to make 175g zinc hydroxide

A: Moles of Zn = 1 Moles of MnO2 = 2 Moles of H2O = 2 Moles of Zn(OH)2 = 1 Moles of MnO(OH) = 2 Mass…

Q: Consider the following equation: Cu(s)+2HBr(aq)->CuBr2(aq)+H2(g) A 25. mL solution of 1.5 M HBr…

A: Molarity of HBr solution = 1.5 MVolume of HBr solution = 25 mL = 0.025 LNumber of moles of HBr =…

Q: A reaction mixture initially contains .25 moles of ZnS and 0.25 moles O2. After the reaction in…

Q: Reaction 1: N2+3H2--->2NH3 Reaction2: 4NH3+5O---->4NO+6H2O Starting with 20.0 mol nitrogen gas…

Q: Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in…

A: The reaction taking place is Mg(OH)₂ (s) + 2 HCl (aq) → 2 H₂O (l) + MgCl₂ (aq) Given : mass of…

Q: Q#6: The following balanced equation will be useful to answer the two questions that follow. MM's…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: How many grams of silver bromide will be formed in the reaction below if you start with 0.05 mol of…

Q: Which of the following equations represents a double replacement reaction? O N205 + H20 → 2HNO3 O…

A: The given reactions are, i. N2O5 + H2O → 2HNO3 ii. Na2Cr2O7 + S →Cr2O3 + Na2SO4 iii. Zn + 2KOH →…

Q: KMNO4 + 5 FeCl2 + 8 HCI -> MnCl2 + 5 FeCl3 + 4 H2O + KCI How many moles of FeCl3 will be produced by…

A: Limiting reagent is the reagent which controls the reaction. When the amount of limiting reagent is…

Q: Identify the limiting reagent in each of the combinations of reagents given in the following…

A: A chemical equation is the symbolic representation of a chemical reaction in form of symbols where…

Q: The reaction below occurs between acetic acid (found in vinegar) and sodium bicarbonate (baking…

Q: 1. How many moles of H2 is produced if there is 0.60 mol of Zn and 0.82 moles of HCI? How many moles…

Q: 2 NaN3(s) ------> 2 Na(s) + 3 N2(g) How many moles of sodium are produced when 0.5 moles of…

A: In balanced equation the no of atoms of same kind in reactant side and in product side are equal. 2…

Q: Sodium metal reacts with water to form aqueous sodium hydroxide and hydrogen gas. Which equation…

A: Given : Reactants - 1) Sodium metal i.e Na 2) water i.e H2O Products - 1) Sodium…

Q: Lithium and nitrogen react in a combination reaction to produce lithium nitride: OLi(a) + N2(g) –…

A: Here i have solved part B

Q: What is the mole-to-mole ratio between the two reactants? Select one: a. 2 mole CaCO3 to 3…

Q: What is the correct number of moles of NO that is produced from 13.2 moles of oxygen gas in the…

A: From the above balanced chemical equation4NH3(g)+5O2(g)→4NO(g)+6H2O(l).We can say that.5 moles of O2…

Q: Given that you have 14.5 moles of N2, how many moles of H2 are theoretically needed to produce 22.5…

A: A chemical reaction is a symbolic representation of the conversion of substances to new substances.…

Q: 2 FeCl, + 3 Zn à 3 ZNC1, + 2 Fe How many moles of Zinc are needed for 3.5 moles of FeCl3 to fully…

A: For the given reaction, 2 FeCl3 + 3 Zn → 3 ZnCl2 + 2Fe

Q: Q11 (A) Describe any 4 types of chemical reactions. Write one example for each type. Q11 (B)…

A: (A) Four types of reaction are given below: 1. Combination reaction: In a combination reaction,…

Q: NH4)2SO4 + Ca(OH)2 -> 2NH3 + CaSO4 + 2H2O Calculate how many moles of Ca(OH)2 are needed to produce…

Q: How many moles of P4010 are needed to produce 15.0 moles of Cl207? 12 HCIO4 + P4010 → 4 H3PO4 + 6…

A: 12 HClO4 + P4O10 ---> 4 H3PO4 + 6 Cl2O7 Moles of Cl2O7 : 15.0 moles Moles of P4O10 = ?

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Balance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acid
3.94 Calcium carbonate (limestone, CaCO3) dissolves in hydrochloric acid, producing water and carbon dioxide. An unbalanced net ionic equation for this reaction is given below. Balance it. CaCO3(s)+H3O+(aq)H2O(l)+CO2(g)+Ca2+(aq)
Balance the following equations, and name each reactant and product: (a) SF4(g) + H2O() SO2(g) + HF() (b) NH3(aq) + O2(aq) NO(g) + H2O() (c) BF3(g) + H2O() HF(aq) + H3BO3(aq)
Consider the following generic equation: H+(aq)+ B(aq)HB(aq)For which of the following pairs would this be the correct prototype equation for the acid-base reaction in solution? If it is not correct, write the proper equation for the acid-base reaction between the pair. (a) nitric acid and calcium hydroxide (b) hydrochloric acid and CH3NH2 (c) hydrobromic acid and aqueous ammonia (d) perchloric acid and barium hydroxide (e) sodium hydroxide and nitrous acid
Aqueous solutions of ammonium sulfide, (NH4)2S, and Hg(NO3)2 react to produce HgS and NH4NO3. (a) Write the overall, balanced equation for the reaction. Indicate the state (s, aq) for each compound. (b) Name each compound. (c) What type of reaction is this?
4.23 In the reaction of arsenic with bromine, AsBr5 will form only when excess bromine is present. Write a balanced chemical equation for this reaction. Determine the minimum number of motes of bromine that are needed if 9.6 moles of arsenic is present.
3.86 When a solution is diluted, solvent is added but solute is not. Explain how this idea leads to the equation frequently used in dilution calculations, M1V1= M2V2.
Chlorine gas was first prepared in 1774 by C. W. Scheele by oxidizing sodium chloride with manganese(IV) oxide. The reaction is NaCl(aq) + H2SO4(aq) + MnO2(s) Na2SO4(aq) + MnCl2(aq) + H2O(l) + Cl2 (g) Balance this equation.
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
A noncarbonated soft drink contains an unknown amount of citric acid, H3C6H5O7. lf 100. mL of the soft drink requires 33.51 mL of 0.0102 M NaOH to neutralize the citric add completely, what mass of citric acid does the soft drink contain per 100. mL? The reaction of citric acid and NaOH is H3C6H5O7(aq) + 3 NaOH(aq) Na3C6H5O7(aq) + 3 H2O()
39. Standard solutions of calcium ion used to test for water hardness are prepared by dissolving pure calcium carbonate. CaCO3, in dilute hydrochloric acid. A 1.745-g sample of CaCO3 is placed in a 250.O-mL volumetric flask and dissolved in HCI. Then the solution is diluted to the calibration mark of the volumetric flask. Calculate the resulting molarity of calcium ion.
What is the difference between a solute and a solvent?